Perfluoropentane

{{chembox

| ImageFile = Perflenapent.svg

| ImageSize = 180

| ImageAlt = Structural formula of perflenapent

| ImageFile1 = Perfluoropentane 3D ball.png

| ImageSize1 = 180

| ImageAlt1 = Ball-and-stick model of the perflenapent molecule

| PIN = Dodecafluoropentane{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = The Royal Society of Chemistry | date = 2014 | location = Cambridge | page = 33 | doi = 10.1039/9781849733069-FP001 | isbn = 978-0-85404-182-4 | quote = The prefix ‘per-’ is no longer recommended. | chapter = Front Matter }}

| OtherNames = Perfluoropentane

|Section1={{Chembox Identifiers

| CASNo = 678-26-2

| PubChem = 12675

| ChemSpiderID = 12154

| ChEBI = 39428

| ChEMBL = 1899801

| EC_number = 211-647-5

| UNII = 483AU1Y5CZ

| Beilstein = 1712388

| KEGG = D05436

| SMILES = C(C(C(F)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F

| InChI = 1/C5F12/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)17

| InChIKey = NJCBUSHGCBERSK-UHFFFAOYAH

| StdInChI = 1S/C5F12/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)17

| StdInChIKey = NJCBUSHGCBERSK-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=5 | F=12

| Density = 1.63 g/mL (liquid, 25 °C){{cite web | url = https://fluoromed.com/products/perfluoropentane-dodecafluoropentane-cas-number-678-26-2 | title = Perfluoropentane | access-date = September 26, 2023}}
1.59 g/mL (liquid, 35 °C)
12.25 kg/m³ (gas, 1 atm, 10 times air density)

| MeltingPtC = -115

| BoilingPtC = 28

| Viscosity = 0.652 mPa*s (25 °C)

| VaporPressure = 83.99 kPa (25 °C)

| BoilingPt_notes =
Heat of vaporization = 21 cal/g

}}

|Section5={{Chembox Thermochemistry

| HeatCapacity = 0.26 cal/(g • K)

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

| MainHazards =

| FlashPt =}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = V08

| ATCCode_suffix = DA03

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

}}

}}

Perfluoropentane (PFP) or dodecafluoropentane; also known as Perflenapent (INN/USAN) is a fluorocarbon, the fluorinated analogue of pentane. It is a liquid that boils at slightly over room temperature.

It has several biomedical applications including: propellant for pressurized metered dose inhalers;Rogueda, P. G. A. HPFP, a Model Propellant for pMDIs. Drug Dev. Ind. Phar. 2003, 29, 39 gas core in microbubble ultrasound contrast agents;Liu, Y., Miyoshi, H., and Nakamura, M. Encapsulated ultrasound microbubbles: Therapeutic application in drug/gene delivery. J. Controlled Release 2006, 114, 89− 99 and occlusion therapy via the conversion of nanometer liquid droplets into micrometer sized gas microbubbles (acoustic droplet vaporization).D. Bardin, T. D. Martz, P. S. Sheeran, R. Shih, P. A. Dayton, and A. P. Lee, “High-speed, clinical-scale microfluidic generation of stable phase-change droplets for gas embolotherapy,” Lab on a Chip, vol. 11, no. 23, p. 3990, 2011.

References

{{reflist}}

{{Contrast media}}

{{pharmacology-stub}}

Category:Perfluoroalkanes

Category:Ultrasound contrast agents