Petunidin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464199623

| Name = Petunidin

| ImageFile=Petunidin.svg

| ImageSize=250px

| IUPACName=3,3′,4′,5,7-Pentahydroxy-5′-methoxyflavylium

| SystematicName=2-(3,4-Dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1λ⁴-benzopyran-1-ylium

| OtherNames=Petunidine; Petunidin chloride;
Petunidol; Myrtillidin

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 390371

| InChI = 1/C16H12O7/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16/h2-6H,1H3,(H4-,17,18,19,20,21)/p+1

| InChIKey = AFOLOMGWVXKIQL-IKLDFBCSAS

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H12O7/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16/h2-6H,1H3,(H4-,17,18,19,20,21)/p+1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AFOLOMGWVXKIQL-UHFFFAOYSA-O

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 1429-30-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WRK4Q8K2D8

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C08727

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 75318

| PubChem = 441774

| SMILES = Oc1cc2c(O)cc(O)cc2[o+]c1c3cc(O)c(O)c(OC)c3

}}

|Section2={{Chembox Properties

| Formula = C₁₆H₁₃O₇⁺ (Cl⁻)

| MolarMass = 317.27 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Petunidin (Pt), like Europinidin and Malvidin, is derived from Delphinidin and is an O-methylated anthocyanidin of the 3-hydroxy type. It is a natural organic compound, a dark-red or purple water-soluble pigment found in many red berries including chokeberries (Aronia sp), Saskatoon berries (Amelanchier alnifolia) or different species of grape (for instance Vitis vinifera, or muscadine, Vitis rotundifolia), and also part of the pigments responsible for the petal colors in many flowers. This pigment gives the Indigo Rose tomatoes the majority of their deep purple color when the fruits are exposed to sunlight.{{Cite web|url=http://horticulture.oregonstate.edu/purple_tomato_faq|title = The Purple Tomato FAQ|date = 2 May 2012}} The name of the molecule itself is derived from the word Petunia.