Phenylacetylrinvanil

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = [(Z,7R)-18-[(4-Hydroxy-3-methoxyphenyl)methylamino]-18-oxooctadec-9-en-7-yl] 2-phenylacetate

| image = Phenylacetylrinvanil.svg

| image_class = skin-invert-image

| width = 250px

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number = 849343-53-9

| PubChem = 25171466

| ChemSpiderID = 74098843

| C=34 | H=49 | N=1 | O=5

| smiles = CCCCCC[C@H](C/C=C\CCCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC)OC(=O)CC2=CC=CC=C2

| StdInChI = 1S/C34H49NO5/c1-3-4-5-15-20-30(40-34(38)26-28-18-13-12-14-19-28)21-16-10-8-6-7-9-11-17-22-33(37)35-27-29-23-24-31(36)32(25-29)39-2/h10,12-14,16,18-19,23-25,30,36H,3-9,11,15,17,20-22,26-27H2,1-2H3,(H,35,37)/b16-10-/t30-/m1/s1

| StdInChIKey = LXLBUUJANYSIKU-DJVRBGHSSA-N

}}

Phenylacetylrinvanil (IDN-5890) is a synthetic analogue of capsaicin which acts as a potent and selective agonist for the TRPV1 receptor, with slightly lower potency than resiniferatoxin, though still around 300 times the potency of capsaicin. It is an amide of vanillylamine and ricinoleic acid, with the hydroxyl group on ricinoleic acid esterified with phenylacetic acid. It is used to study the function of the TRPV1 receptor and its downstream actions, and has also shown anti-cancer effects in vitro.{{cite journal | vauthors = Appendino G, De Petrocellis L, Trevisani M, Minassi A, Daddario N, Moriello AS, Gazzieri D, Ligresti A, Campi B, Fontana G, Pinna C, Geppetti P, Di Marzo V | display-authors = 6 | title = Development of the first ultra-potent "capsaicinoid" agonist at transient receptor potential vanilloid type 1 (TRPV1) channels and its therapeutic potential | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 312 | issue = 2 | pages = 561–70 | date = February 2005 | pmid = 15356216 | doi = 10.1124/jpet.104.074864 | s2cid = 816699 }}{{cite journal | vauthors = Luviano A, Aguiñiga-Sánchez I, Demare P, Tiburcio R, Ledesma-Martínez E, Santiago-Osorio E, Regla I | title = Antineoplastic activity of rinvanil and phenylacetylrinvanil in leukaemia cell lines | journal = Oncology Letters | volume = 7 | issue = 5 | pages = 1651–1656 | date = May 2014 | pmid = 24765194 | doi = 10.3892/ol.2014.1958 | pmc = 3997731 | doi-access = free }}{{cite journal | vauthors = Sánchez-Sánchez L, Alvarado-Sansininea JJ, Escobar ML, López-Muñoz H, Hernández-Vázquez JM, Monsalvo-Montiel I, Demare P, Regla I, Weiss-Steider B | display-authors = 6 | title = Evaluation of the antitumour activity of Rinvanil and Phenylacetylrinvanil on the cervical cancer tumour cell lines HeLa, CaSKi and ViBo | journal = European Journal of Pharmacology | volume = 758 | pages = 129–36 | date = July 2015 | pmid = 25864613 | doi = 10.1016/j.ejphar.2015.04.003 }}

References

{{Reflist}}

{{Transient receptor potential channel modulators}}

Category:Capsaicinoids

Category:Transient receptor potential channel modulators

{{pharm-stub}}