Phenylsilatrane

{{Chembox

| ImageFile = Phenylsilatrane.svg

| ImageSize = 120

| ImageName = Stereo structural formula of phenylsilatrane

| PIN = (TBPY-5-23)-8-Phenyltetrahydro-4H-4λ⁵-8,4-(epoxyethano)[1,3,2]oxazasilolo[3,2-b][1,3,2]oxazasilol-4-ylium-8-uide

|Section1={{Chembox Identifiers

| CASNo = 2097-19-0

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 694OD9N65R

| PubChem = 5147995

| ChemSpiderID = 4321483

| ChemSpiderID_Ref = {{Chemspidercite|correct|ChemSpider}}

| SMILES = C1C[N+]23CCO[Si-]2(O1)(OCC3)C1=CC=CC=C1

| StdInChI = 1S/C12H17NO3Si/c1-2-4-12(5-3-1)17-13(6-9-14-17,7-10-15-17)8-11-16-17/h1-5H,6-11H2

| StdInChIKey = LDOWJVBCZRHOKX-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=12 | H=17 | N=1 | O=3 | Si=1

}}

|Section7={{Chembox Hazards

| MainHazards = Toxic

| FlashPt =

| HPhrases =

| PPhrases =

| GHS_ref =

}}

}}

Phenylsilatrane is a convulsant chemical which has been used as a rodenticide.{{ cite journal | vauthors = Voronkov MG | title = Silatranes: Intra-Complex Heterocyclic Compounds of Pentacoordinated Silicon | journal = Pure and Applied Chemistry | year = 1966 | volume = 13 | issue = 1–2 | pages = 35–60 | doi = 10.1351/pac196613010035 | url = http://media.iupac.org/publications/pac/1966/pdf/1301x0035.pdf }}{{ cite journal | vauthors = Lukevics E, Ignatovich L, Khokhlova L, Belyakov S | title = Synthesis, Structure, and Toxicity of Arylgermatranes | journal = Chemistry of Heterocyclic Compounds | year = 1997 | volume = 33 | issue = 2 | pages = 239–241 | doi = 10.1007/BF02256767 }} Phenylsilatrane and some of its analogs with 4-substituents of H, CH₃, Cl, Br, and CSi(CH₃)₃ are highly toxic to mice. They have been observed in the laboratory to inhibit the ³⁵S-tert-butylbicyclophosphorothionate (TBPS) binding site (GABA-gated chloride channel) of mouse brain membranes.{{ cite journal | vauthors = Horsham MA, Palmer CJ, Cole LM, Casida JE | title = 4-Alkynylphenylsilatranes: Insecticidal Activity, Mammalian Toxicity, and Mode of Action | journal = Journal of Agricultural and Food Chemistry | year = 1990 | volume = 38 | issue = 8 | pages = 1734–1738 | doi = 10.1021/jf00098a023 }}