Potassium trispyrazolylborate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 423086267

| ImageFile = Potassium trispyrazolylborate.svg

| ImageClass = skin-invert-image

| ImageSize =

| ImageAlt =

| PIN = Potassium tri(1H-pyrazol-1-yl)boranuide

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 18583-60-3

| PubChem = 2725019

| SMILES1 = [H][B-](N1N=CC=C1)(N2N=CC=C2)N3N=CC=C3.[K+]

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2007131

| SMILES2 = [BH-](n1cccn1)(n2cccn2)n3cccn3.[K+]

| InChI = 1/C9H10BN6.K/c1-4-11-14(7-1)10(15-8-2-5-12-15)16-9-3-6-13-16;/h1-10H;/q-1;+1

| InChIKey = IBNGZWIUPDMZMG-UHFFFAOYAZ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C9H10BN6.K/c1-4-11-14(7-1)10(15-8-2-5-12-15)16-9-3-6-13-16;/h1-10H;/q-1;+1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = IBNGZWIUPDMZMG-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C =9 | H=10 | B=1 | K=1 | N=6

| Appearance =

| Density =

| MeltingPtC = 188 to 189

| MeltingPt_ref =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Potassium trispyrazolylborate, commonly abbreviated KTp, is the potassium salt with the formula :{{chem2|KHB(C3N2H3)3}}. This salt is the source of the trispyrazolylborate ligand.{{cite journal | last1 = Trofimenko | first1 = Swiatoslaw | journal = J. Am. Chem. Soc. | title = Boron-pyrazole chemistry. II. Poly(1-pyrazolyl)-borates | volume = 89 | issue = 13 | pages = 3170–3177 | year = 1967 | doi = 10.1021/ja00989a017 }}

KTp is a white crystalline solid that is soluble in polar solvents, alcohols, and water. The synthesis of KTp involves potassium borohydride and pyrazole without a solvent.{{cite book | last1 = Trofimenko | first1 = Swiatoslaw | chapter = Poly(1-pyrazolyl)borates, Their Transition-Metal Complexes, and Pyrazaboles | title = Inorganic Syntheses | volume = 12 | pages = 99–109 | year = 1970 | doi = 10.1002/9780470132432.ch18 | isbn = 9780470132432 }}

:{{chem2|KBH4 + 3 C3N2H4 → KHB(C3N2H3)3 + 3 H2}}

Image:LnMTp.png

The tris(pyrazolyl)borate forms octahedral coordination compounds with the formula M[Tp]₂ with first row transition metals. KTp also forms 1:1 complexes, for example it can be converted to K[TpMo(CO)₃];

:{{chem2|KTp + Mo(CO)₆→K[TpMo(CO)3] + 3 CO}}

When K[TpMo(CO)₃] is treated with butyl nitrite it yields the neutral orange complex TpMo(CO)₂NO.{{cite book | last1 = Trofimenko | first1 = Swiatoslaw | publisher= World Scientific Publishing Company | title =Scorpionates: Polypyrazolylborate Ligands and Their Coordination Chemistry. | year = 1999 |isbn=978-1860941726 }}

:K[TpMo(CO)₃]+ BuONO→TpMo(CO)₂NO+CO+KOBu