Procyanidin A2
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 449573582
| Name = Procyanidin A2
| Reference =
| ImageFile = Proanthocyanidin A2.svg
| ImageName = Chemical structure of proanthocyanidin A2
| ImageSize =
| IUPACName = (2R,3R,8S,14R,15R)-2,8-bis(3,4-dihydroxyphenyl)-2,3,4,14-tetrahydro-8,14-methanobenzo[7,8][1,3]dioxocino[4,5-h]chromene-3,5,11,13,15-pentaol
| OtherNames = Dimeric catechin
Procyanidin A2
Procyanidol A2
Proanthocyanidin A-2
Procyanidin dimer A2
(+)-Proanthocyanidin A2
Epicatechin-(2β→7,4β→8)-epicatechin
|Section1={{Chembox Identifiers
| CASNo = 41743-41-3
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 124025
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UQN6668Q4R
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28472
| SMILES = C1[C@H]([C@H](OC2=C3[C@@H]4[C@H]([C@@](OC5=CC(=CC(=C45)O)O)(OC3=CC(=C21)O)C6=CC(=C(C=C6)O)O)O)C7=CC(=C(C=C7)O)O)O
| ChemSpiderID = 110541
| InChI = 1/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26-,27-,29-,30+/m1/s1
| InChIKey = NSEWTSAADLNHNH-LSBOWGMIBO
| StdInChI = 1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26-,27-,29-,30+/m1/s1
| StdInChIKey = NSEWTSAADLNHNH-LSBOWGMISA-N
}}
|Section2={{Chembox Properties
| C=30 | H=24 | O=12
| Appearance =
| Density =
| MeltingPtC =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Procyanidin A2 is an A type proanthocyanidin.
It is found in avocado,[http://www.liberherbarum.com/Minor/UK/IN3412.htm Proanthocyanidin-A-2 on liberherbarum.com] chestnut,{{cite journal |title=Proanthocyanidin-A2: a new polyphenol |last1=Facino |first1=R. Maffei |last2=Carini |first2=M. |last3=Brambilla |first3=A. |last4=Bombardelli |first4=E. |last5=Morazzoni |first5=P. |year=1996 |journal=Cosmetics & Toiletries}}{{cite journal | pmid = 21803362 | doi=10.1016/j.chroma.2011.07.024 | volume=1218 | issue=42 | title=Structural analysis of A-type or B-type highly polymeric proanthocyanidins by thiolytic degradation and the implication in their inhibitory effects on pancreatic lipase | year=2011 | journal=J Chromatogr A | pages=7704–12 | last1 = Kimura | first1 = H | last2 = Ogawa | first2 = S | last3 = Akihiro | first3 = T | last4 = Yokota | first4 = K}} cranberry juice concentrate,{{cite journal | url = http://www.ars.usda.gov/research/publications/publications.htm?seq_no_115=234202 | title = Determination of Proanthocyanidin A2 Content in Phenolic Polymer Isolates by Reversed-Phase High Performance Liquid Chromatography | author = Koerner Jayma, Hsu Victor, Lee Jungmin, Kennedy, James | year = 2009 | journal = Journal of Chromatography A | volume = 1216 | pages = 1403–1409 | doi = 10.1016/j.chroma.2008.12.086 | pmid = 19168185 | issue = 9}} lychee fruit pericarp,Sarni-Manchado P, Le Roux E, Le Guerneve C, Lozano Y, Cheynier V. Phenolic composition of litchi fruit pericarp" J Agric Food Chem 2000;48(12):5995-6002. peanut skins,{{cite journal | url = http://cat.inist.fr/?aModele=afficheN&cpsidt=1831517 | title = A-type proanthocyanidins from peanut skins |author1=Hongxiang Lou |author2=Yamazaku Y. |author3=Sasaku T. |author4=Uchida M. |author5=Tanaka H. |author6=Oka S. | year = 1999 | journal = Phytochemistry | volume = 51 | issue = 2 | pages = 297–308 | doi = 10.1016/S0031-9422(98)00736-5}} Cinchona cortex, cinnamon cortex, Urvillea ulmaceae,{{cite journal | doi = 10.1080/13880200902933336 | title = Free radical scavenging activity and chemical constituents of Urvillea ulmaceae | year = 2009 | last1 = Dias | first1 = Suziane A. | last2 = Cardoso (Gazio) | first2 = Flávia P. | last3 = Santin | first3 = Silvana M. O. | last4 = Da Costa | first4 = Willian F. | last5 = Vidotti | first5 = Gentil J. | last6 = De Souza | first6 = Maria Conceição | last7 = Sarragiotto | first7 = Maria Helena | journal = Pharmaceutical Biology | volume = 47 | issue = 8 | pages = 717–720| s2cid = 54906659 }} and Ecdysanthera utilis.{{cite journal | doi = 10.1021/np010414l | title = Immunomodulatory Proanthocyanidins from Ecdysantherautilis | year = 2002 | last1 = Lin | first1 = Lie-Chwen | last2 = Kuo | first2 = Yuh-Chi | last3 = Chou | first3 = Cheng-Jen | journal = Journal of Natural Products | volume = 65 | issue = 4 | pages = 505–8 | pmid = 11975489}}
Synthesis
Procyanidin B2 can be converted into procyanidin A2 by radical oxidation using 1,1-diphenyl-2-picrylhydrazyl (DPPH) radicals under neutral conditions.{{cite journal | last1 = Kondo | first1 = Kazunari | last2 = Kurihara | first2 = Masaaki | last3 = Fukuhara | first3 = Kiyoshi | last4 = Tanaka | first4 = Takashi | last5 = Suzuki | first5 = Takashi | last6 = Miyata | first6 = Naoki | last7 = Toyoda | first7 = Masatake | year = 2000 | title = Conversion of procyanidin B-type (catechin dimer) to A-type: evidence for abstraction of C-2 hydrogen in catechin during radical oxidation | journal = Tetrahedron Letters | volume = 41 | issue = 4| pages = 485–488 | doi = 10.1016/S0040-4039(99)02097-3 }}
References
{{reflist}}
- {{cite journal | last1 = Wen | first1 = LR | last2 = Wu | first2 = D | last3 = Jiang | first3 = YM | last4 = Prasad | first4 = KN | last5 = Lin | first5 = S | last6 = Jiang | first6 = GX | last7 = He | first7 = JR | last8 = Zhao | first8 = MM | last9 = Luo | first9 = W | last10 = Yang | first10 = B | year = 2014 | title = Identification of flavonoids in litchi (Litchi chinensis Sonn.) leaf and evaluation of anticancer activities | journal = Journal of Functional Foods | volume = 6 | pages = 555–563 | doi = 10.1016/j.jff.2013.11.022 }}
{{Procyanidin}}
{{Aromatic-stub}}