Propoxate

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = Propyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate

| image = propoxate.svg

| CAS_number = 7036-58-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = M42D353K88

| ATC_prefix = None

| ATC_suffix =

| PubChem = 65591

| DrugBank =

| ChemSpiderID = 59033

| chemical_formula =

| C=15 | H=18 | N=2 | O=2

| SMILES = CCCOC(=O)c1cncn1C(C)c2ccccc2

| StdInChI = 1S/C15H18N2O2/c1-3-9-19-15(18)14-10-16-11-17(14)12(2)13-7-5-4-6-8-13/h4-8,10-12H,3,9H2,1-2H3

| StdInChIKey = LKGPZAQFNYKISK-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Propoxate (INN; R7464) is an unmarketed anesthetic related to etomidate and metomidate. Although not employed in the treatment of humans, it has been used as an anesthetic in fish.{{cite book|vauthors=Ross LG, Ross B|title=Anaesthetic and Sedative Techniques for Aquatic Animals|url=https://books.google.com/books?id=ghusg7fwLVsC&pg=PA111|date=22 January 2009|publisher=John Wiley & Sons|isbn=978-1-4443-0227-1|pages=111–}}{{cite book|vauthors=Hoar WS, Randall DJ|title=FISH PHYSIOLOGY|url=https://books.google.com/books?id=MTXiVzg44sEC&pg=PA517|date=28 April 1972|publisher=Academic Press|isbn=978-0-08-058526-0|pages=517–}}