Proscillaridin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464375437

| IUPAC_name = 5-[(3S,8R,9S,10R,13R,14S,17R)-14-Hydroxy- 10,13-dimethyl-3-((2R,3R,4R,5R,6R)-3,4,5-trihydroxy- 6-methyltetrahydro-2H-pyran-2-yloxy)-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro- 1H-cyclopenta[a]phenanthren-17-yl]-2H-pyran-2-one

| image = Proscillaridin structure.svg

| tradename =

| Drugs.com = {{drugs.com|international|proscillaridin}}

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 466-06-8

| ATC_prefix = C01

| ATC_suffix = AB01

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 600325

| PubChem = 5284613

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4447658

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KC6BL281EN

| synonyms = 14β-Hydroxy-3β-[α-L-rhamnopyranosyl)oxy]bufa-4,20,22-trienolide

| C=30 | H=42 | O=8

| smiles = O=C1OC=C([C@H]2CC[C@]3([C@@]2(CC[C@H]4[C@H]3CCC5=C[C@H](CC[C@@]54C)O[C@@H]6O[C@@H](C)[C@@H]([C@H]([C@H]6O)O)O)C)O)C=C1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C30H42O8/c1-16-24(32)25(33)26(34)27(37-16)38-19-8-11-28(2)18(14-19)5-6-22-21(28)9-12-29(3)20(10-13-30(22,29)35)17-4-7-23(31)36-15-17/h4,7,14-16,19-22,24-27,32-35H,5-6,8-13H2,1-3H3/t16-,19-,20+,21-,22+,24-,25+,26+,27-,28-,29+,30-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MYEJFUXQJGHEQK-ALRJYLEOSA-N

}}

Proscillaridin is a cardiac glycoside, a kind of drug that can be used in the treatment of congestive heart failure and cardiac arrhythmia (irregular heartbeat). It is of the bufanolide type and can be obtained from plants of the genus Scilla and in Drimia maritima (Scilla maritima).{{cite journal | vauthors = Kedra M, Kedrowa S | title = [Clinical evaluation of Proscillaridin A, a glycoside of Scilla maritima] | journal = Polski Tygodnik Lekarski | volume = 23 | issue = 19 | pages = 714–6 | date = May 1968 | pmid = 4876207 }}

The aglycone of proscillaridin is scillarenin.