RTI-32
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 401640840
| IUPAC_name = Methyl (1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate
| image = Phenyltropane 11f.svg
| tradename =
| CAS_number = 130342-81-3
| ATC_prefix =
| ATC_suffix =
| PubChem = 125416
| ChemSpiderID = 111596
| ChEMBL = 1947089
| C=17 | H=23 | N=1 | O=2
| smiles = CC1=CC=C(C=C1)[C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)OC)N3C
| StdInChI = 1S/C17H23NO2/c1-11-4-6-12(7-5-11)14-10-13-8-9-15(18(13)2)16(14)17(19)20-3/h4-7,13-16H,8-10H2,1-3H3/t13-,14+,15+,16-/m0/s1
| StdInChIKey = MMKZDDDDODERSJ-JJXSEGSLSA-N
}}
(–)-2β-Carbomethoxy-3β-(4-tolyl)tropane (RTI-4229-32, tolpane) is a phenyltropane-based cocaine analogue that has similar properties in vitro to related drugs such as RTI-31.{{cite journal | vauthors = Remy P, Doder M, Lees A, Turjanski N, Brooks D | title = Depression in Parkinson's disease: loss of dopamine and noradrenaline innervation in the limbic system | journal = Brain | volume = 128 | issue = Pt 6 | pages = 1314–22 | date = June 2005 | pmid = 15716302 | doi = 10.1093/brain/awh445 | doi-access = free }}{{cite journal | vauthors = Xu L, Izenwasser S, Katz JL, Kopajtic T, Klein-Stevens C, Zhu N, Lomenzo SA, Winfield L, Trudell ML | display-authors = 6 | title = Synthesis and biological evaluation of 2-substituted 3beta-tolyltropane derivatives at dopamine, serotonin, and norepinephrine transporters | journal = Journal of Medicinal Chemistry | volume = 45 | issue = 6 | pages = 1203–10 | date = March 2002 | pmid = 11881989 | doi = 10.1021/jm010453u }}
class="wikitable"
| Compound | DAT | DA | NET | NA | SERT | 5HT | ED50 |
Troparil | 23 | 49.8 | 550 | 37.2 | 178 | 173 | 0.34 |
RTI-32 | 1.7 | 7.02 | 36 | 8.42 | 23 | 19.4 | 0.31 |
RTI-31 | 1.1 | 3.68 | 22 | 5.86 | 4.0 | 5.0 | 0.13 |
3'4'-xylyl | 0.43 | unknown | 44 | unknown | 2.42 | unknown |
See also
References
{{reflist}}
{{Phenyltropanes}}
{{Stimulants}}
{{Dopaminergics}}
Category:Dopamine reuptake inhibitors