Rimiterol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 464382597

| IUPAC_name = 4-{(S)-hydroxy[(2R)-piperidin-2-yl]methyl}benzene-1,2-diol

| image = Rimiterol.svg

| width = 200

| image2 = Rimiterol ball-and-stick model.png

| tradename =

| pregnancy_AU = A

| pregnancy_US =

| pregnancy_category =

| legal_AU = S4

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 32953-89-2

| ATC_prefix = R03

| ATC_suffix = AC05

| ATC_supplemental =

| PubChem = 36283

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1097630

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 33366

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 26GIW6ZLPH

| C = 12

| H = 17

| N = 1

| O = 3

| smiles = O[C@@H](c1ccc(O)c(O)c1)[C@@H]2NCCCC2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H17NO3/c14-10-5-4-8(7-11(10)15)12(16)9-3-1-2-6-13-9/h4-5,7,9,12-16H,1-3,6H2/t9-,12+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = IYMMESGOJVNCKV-SKDRFNHKSA-N

}}

Rimiterol (INN/USAN) is a third-generation{{cite journal | vauthors = Palma-Carlos AG, Palma-Carlos GS | title = Beta-2-agonists of third generation | journal = Allergie et Immunologie | volume = 18 | issue = 4 | pages = 31–2, 35 | date = April 1986 | pmid = 2899434 }} short-acting{{cite journal | vauthors = Lai CK, Twentyman OP, Holgate ST | title = The effect of an increase in inhaled allergen dose after rimiterol hydrobromide on the occurrence and magnitude of the late asthmatic response and the associated change in nonspecific bronchial responsiveness | journal = The American Review of Respiratory Disease | volume = 140 | issue = 4 | pages = 917–23 | date = October 1989 | pmid = 2572192 | doi = 10.1164/ajrccm/140.4.917 }}{{cite journal | vauthors = Ydreborg SO, Svedmyr N, Thiringer G | title = Comparison of rimiterol and terbutaline, given by aerosol, in a long-term study | journal = Scandinavian Journal of Respiratory Diseases | volume = 58 | issue = 2 | pages = 117–24 | date = April 1977 | pmid = 16339 }} β₂ agonist.