Ro20-8065

{{Short description|Chemical compound}}

{{drugbox

| drug_name = Ro20-8065

| image = Ro20-8065.svg

| image_class = skin-invert-image

| legal_CA = Schedule IV

| legal_UK = PSA

| legal_DE = NpSG

| C = 15 | H = 9 | Cl = 2 | F = 1 | N = 2 | O = 1

| IUPAC_name = 7,8-dichloro-5-(2-fluorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one

| CAS_number = 88695-06-1

| ChemSpiderID = 8534252

| PubChem = 10358803

| ChEMBL = 443823

| smiles = C1C(=O)NC2=CC(=C(C=C2C(=N1)C3=CC=CC=C3F)Cl)Cl

| StdInChI = 1S/C15H9Cl2FN2O/c16-10-5-9-13(6-11(10)17)20-14(21)7-19-15(9)8-3-1-2-4-12(8)18/h1-6H,7H2,(H,20,21)

| StdInChIKey = XINLNKMOSCQFJB-UHFFFAOYSA-N

}}

Ro20-8065 (8-Chloronorflurazepam) is a benzodiazepine derivative with anticonvulsant and muscle relaxant effects,{{cite journal | vauthors = Zhang W, Koehler KF, Harris B, Skolnick P, Cook JM | title = Synthesis of benzo-fused benzodiazepines employed as probes of the agonist pharmacophore of benzodiazepine receptors | journal = Journal of Medicinal Chemistry | volume = 37 | issue = 6 | pages = 745–57 | date = March 1994 | pmid = 8145224 | doi = 10.1021/jm00032a007 }} which has been sold as a designer drug.{{cite journal | vauthors = Catalani V, Botha M, Corkery JM, Guirguis A, Vento A, Scherbaum N, Schifano F | title = The Psychonauts' Benzodiazepines; Quantitative Structure-Activity Relationship (QSAR) Analysis and Docking Prediction of Their Biological Activity | journal = Pharmaceuticals (Basel, Switzerland) | volume = 14 | issue = 8 | date = July 2021 | page = 720 | pmid = 34451817 | pmc = 8398354 | doi = 10.3390/ph14080720 | doi-access = free }}

See also

References

{{Reflist}}

{{Benzodiazepines}}

{{Hypnotics and sedatives}}

{{GABAAR PAMs}}

Category:Designer drugs

Category:2-Fluorophenyl compounds

Category:Benzodiazepines

Category:Chlorobenzene derivatives

{{pharm-stub}}