Rubidium acetate

{{Chembox

| Reference = {{cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/23673628|title=Rubidium acetate|website=pubchem.ncbi.nlm.nih.gov}}{{cite web|url=http://www.gelest.com/wp-content/uploads/product_msds/CXRB010-msds.pdf |title=CXRB010_ RUBIDIUM ACETATE, monohydrate |format=PDF |date= |accessdate=2021-02-03}}{{cite web|url=https://www.chemicalbook.com/ChemicalProductProperty_EN_CB1126064.htm|title=RUBIDIUM ACETATE | 563-67-7|website=www.chemicalbook.com}}{{cite web|url=https://s3.amazonaws.com/gelest/sds/CXRB010_GHS+US_English+US.pdf |title=Safety data sheet |publisher=s3.amazonaws.com |date=2015 |accessdate=2021-02-03}}

| Name = Rubidium acetate

| IUPACName = Rubidium acetate

| PIN =

| SystematicName =

| OtherNames = {{Unbulleted list

| Rubidium(I) acetate

}}

| data page pagename =

| ImageFile = rubidium acetate.svg

| ImageSize = 200px

| ImageAlt =

| ImageName =

| ImageCaption =

| Section1 = {{Chembox Identifiers

| 3DMet =

| Abbreviations =

| Beilstein =

| CASNo = 563-67-7

| CASNo_Comment =

| ChEBI =

| ChemSpiderID = 144356

| EC_number = 209-255-4

| Gmelin =

| KEGG =

| MeSHName =

| PubChem = 23673628

| RTECS =

| UNII = 86H795SZ6D

| UNNumber =

| StdInChI=1S/C2H4O2.Rb/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1

| StdInChIKey = FOGKDYADEBOSPL-UHFFFAOYSA-M

| SMILES = CC(=O)[O-].[Rb+]

}}

| Section2 = {{Chembox Properties

| AtmosphericOHRateConstant =

| Appearance = White solid

| BoilingPt =

| BoilingPtC =

| BoilingPt_ref =

| BoilingPt_notes =

| Density =

| Formula =

| HenryConstant =

| LogP = −0.561

| MolarMass = 144.51 g/mol

| MeltingPt =

| MeltingPtC = 246

| MeltingPt_ref =

| MeltingPt_notes = (decomposes)

| pKa =

| pKb =

| Solubility = 85 g/100 ml (45 °C)

| SolubleOther =

| Solvent =

| VaporPressure =

}}

| Section3 = {{Chembox Structure

| Coordination =

| CrystalStruct =

| MolShape =

}}

| Section4 = {{Chembox Thermochemistry

| DeltaGf =

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity =

}}

| Section7 = {{Chembox Hazards

| AutoignitionPt =

| ExploLimits =

| FlashPt =

| LD50 =

| LC50 =

| MainHazards =

| NFPA-F = 1

| NFPA-H = 0

| NFPA-R = 1

| NFPA-S =

| PEL = TWA 1 mg/m³

| REL =

| ExternalSDS =

| GHSPictograms =

| GHSSignalWord =

| HPhrases = {{H-phrases|305|315}}

| PPhrases =

}}

| Section9 = {{Chembox Related

| OtherAnions = rubidium formate

| OtherCations = Hydrogen acetate
Lithium acetate
Sodium acetate
Potassium acetate
Caesium acetate

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Rubidium acetate is a rubidium salt that is the result of reacting rubidium metal, rubidium carbonate, or rubidium hydroxide with acetic acid. It is soluble in water like other acetates.