Sedoheptulose 7-phosphate

{{chembox

| Verifiedfields = changed

| verifiedrevid = 476997500

| ImageFile = Sedoheptulose 7-phosphate.svg

| ImageSize =

| IUPACName = D-altro-Hept-2-ulose 7-phosphate

| OtherNames =

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 144663

| InChI = 1/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1

| InChIKey = JDTUMPKOJBQPKX-GBNDHIKLBF

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JDTUMPKOJBQPKX-GBNDHIKLSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 2646-35-7

| PubChem = 165007

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 15721

| SMILES = O=P(O)(OC[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO)O

| MeSHName = sedoheptulose+7-phosphate

}}

| Section2 = {{Chembox Properties

| C=7 | H=15 | O=10 | P=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Sedoheptulose 7-phosphate is an intermediate in the pentose phosphate pathway.{{cite web | url = https://hmdb.ca/metabolites/HMDB0001068 | title = Metabocard for D-Sedoheptulose 7-phosphate | work = Human Metabolism Database }}

It is formed by transketolase and acted upon by transaldolase.

Sedoheptulokinase is an enzyme that uses sedoheptulose and ATP to produce ADP and sedoheptulose 7-phosphate.

Sedoheptulose-bisphosphatase is an enzyme that uses sedoheptulose 1,7-bisphosphate and H₂O to produce sedoheptulose 7-phosphate and phosphate.