sedoheptulose

{{chembox

| Verifiedfields = changed

| verifiedrevid = 464388307

| ImageFile = Sedoheptulose.svg

| ImageSize = 200px

| IUPACName = D-altro-Hept-2-ulose{{Cite web |title=2-Carb-10 |url=https://iupac.qmul.ac.uk/2carb/10.html |access-date=2023-11-14 |website=iupac.qmul.ac.uk}}

| OtherNames = D-altro-2-Heptulose; D-altro-Heptulose

| SystematicName = (3S,4R,5R,6R)-1,3,4,5,6,7-Hexahydroxyheptan-2-one

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4573620

| InChI = 1/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7-/m1/s1

| InChIKey = HSNZZMHEPUFJNZ-SHUUEZRQBR

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HSNZZMHEPUFJNZ-SHUUEZRQSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 3019-74-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 40A0W1XJ6X

| PubChem = 5459879

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16802

| SMILES = O=C([C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO)CO

| MeSHName = Sedoheptulose

}}

| Section2 = {{Chembox Properties

| C=7|H=14|O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Sedoheptulose or pseudoheptulose or D-altro-heptulose is a ketoheptose—a monosaccharide with seven carbon atoms and a ketone functional group. It is one of the few heptoses found in nature, and is found in various fruits and vegetables ranging from carrots and leeks to figs, mangos and avocados.{{cite journal |last1=Ogata |first1=James N. |last2=Kawano |first2=Yoshihiko |last3=Bevenue |first3=Arthur |last4=Casarett |first4=Louis J. |title=Ketoheptose content of some tropical fruits |journal=Journal of Agricultural and Food Chemistry |date=January 1972 |volume=20 |issue=1 |pages=113–115 |doi=10.1021/jf60179a011|pmid=5059931 }}{{cite journal |last1=Okuda |first1=Takuo |last2=Mori |first2=Kazuko |title=Distribution of manno-heptulose and sedoheptulose in plants |journal=Phytochemistry |date=June 1974 |volume=13 |issue=6 |pages=961–964 |doi=10.1016/S0031-9422(00)91430-4|bibcode=1974PChem..13..961O }}

It is an intermediate in respiratory and photosynthetic pathways and plays a vital role in the non-oxidative branch of the pentose phosphate pathway.{{Cite journal | doi = 10.1021/ja01104a532| title = Transaldolase: The Formation of Fructose-6-Phosphate from Sedoheptulose-7-Phosphate| journal = Journal of the American Chemical Society| volume = 75| issue = 8| pages = 2021| year = 1953| last1 = Horecker| first1 = B. L| last2 = Smyrniotis| first2 = P. Z}}{{Cite journal| doi = 10.1016/j.tibs.2014.06.005 | pmid = 25037503 | title = The pentose phosphate pathway and cancer | journal = Trends in Biochemical Sciences | volume = 39 | issue = 8 | pages = 347–354 | year = 2014 | last1 = Patra | first1 = Krushna C | last2 = Hay | first2 = Nissim | pmc=4329227}}

Studies have shown that 7-O-galloyl-D-sedoheptulose, a chemical extracted from dogwood fruit, is able to reduce pro-inflammatory markers in vivo such as interleukin-6 (IL-6) and C-reactive protein and thus might be able reduce low-level inflammation in humans.{{cite journal |last1=Park |first1=Chan Hum |last2=Tanaka |first2=Takashi |last3=Yokozawa |first3=Takako |title=Evaluation of 7-O-galloyl-d-sedoheptulose, isolated from Corni Fructus, in the adipose tissue of type 2 diabetic db/db mice |journal=Fitoterapia |date=September 2013 |volume=89 |pages=131–142 |doi=10.1016/j.fitote.2013.03.026 |pmid=23567861 |issn=0367-326X}} While this compound contains a sedoheptulose moiety, sedoheptulose itself has not been shown to possess the same properties.