Silicon disulfide

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464390444

| ImageFile1 = SiS2typeSilica.png

| ImageSize1 = 300px

| ImageFile2 = SiS2-chain-from-Ibam-xtal-2015-3D-balls.png

| ImageSize2 = 300px

| ImageFile3 = SiS2.png

| ImageSize3 = 300px

| IUPACName = silicon(IV) sulfide

| SystematicName =

| OtherNames = silicon disulfide

|Section1={{Chembox Identifiers

| Abbreviations =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 75527

| InChI = 1/S2Si/c1-3-2

| InChIKey = KHDSWONFYIAAPE-UHFFFAOYAO

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/S2Si/c1-3-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KHDSWONFYIAAPE-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 13759-10-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 35Y5PHW16K

| EINECS =

| PubChem = 83705

| SMILES = S=[Si]=S

| SMILES_Comment = monomer

| SMILES1 = S=[Si](S0)S[Si]0(S0)S[Si]0(S0)S[Si]0(S0)S[Si]0(S0)S[Si]0(S0)S[Si]0=S

| SMILES1_Comment = polymer

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| Formula = SiS₂

| MolarMass = 92.218 g/mol

| Appearance = White (samples are sometimes grey or brown) needles.
Rotten egg smell in moist air.

| Density = 1.853 g/cm³

| MeltingPtC = 1090

| MeltingPt_notes = sublimes

| BoilingPtC =

| BoilingPt_notes =

| Solubility = Decomposes

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

}}

|Section3={{Chembox Structure

| Coordination = Tetrahedral

| CrystalStruct = Orthorhombic, oI12

| SpaceGroup = Ibam, No.72{{cite journal |author1=Weiss, A. |author2=Weiss, A. | title = Über Siliciumchalkogenide. VI. Zur Kenntnis der faserigen Siliciumdioxyd-Modifikation | journal = Zeitschrift für Anorganische und Allgemeine Chemie | year = 1954 | volume = 276 | issue = 1–2 | pages = 95–112 | doi = 10.1002/zaac.19542760110 }}

}}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity =

}}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US =

}}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

|Section7={{Chembox Hazards

| MainHazards =

| NFPA-H = 2

| NFPA-F = 2

| NFPA-R = 3

| NFPA-S =

| HPhrases =

| PPhrases =

| GHS_ref =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions = silicon dioxide

| OtherCations = carbon disulfide
germanium disulfide
tin(IV) sulfide
lead(IV) sulfide

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Silicon disulfide is the inorganic compound with the formula SiS₂. Like silicon dioxide, this material is polymeric, but it adopts a 1-dimensional structure quite different from the usual forms of SiO₂.