Sodium fluorosilicate

{{Chembox

| PIN = Sodium fluorosilicate

| SystematicName = Sodium hexafluoridosilicate(2–)

{{cite manual|section = Parent Hydride Names and Substitutive Nomenclature|url = http://old.iupac.org/publications/books/rbook/Red_Book_2005.pdf|title = Nomenclature of Inorganic Chemistry, IUPAC Recommendations 2005|publisher = RSC Publishing|year = 2005|pages = 114–135}}

| OtherNames = Disodium hexafluorosilicate/sodium fluosilicate/sodium silicofluoride

| ImageFile = Natriumhexafluorosilicat.png

| ImageSize = 250px

| ImageAlt = Unit cell of the compound

| ImageCaption = Unit cell of sodium hexafluoridosilicate

|Section1={{Chembox Identifiers

| CASNo = 16893-85-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 806AV2E065

| PubChem = 28127

| ChemSpiderID = 26165

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| EINECS = 240-934-8

| UNNumber = 2674

| RTECS = VV8410000

| SMILES = [Na+].[Na+].F[Si--](F)(F)(F)(F)F

| StdInChI = 1S/F6Si.2Na/c1-7(2,3,4,5)6;;/q-2;2*+1

| StdInChIKey = TWGUZEUZLCYTCG-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| Formula= Na₂[SiF₆]

| MolarMass = 188 g/mol

| Appearance = white granular powder

| Odor = odorless

| Density = 2.7 g/cm³

| Solubility = 0.64 g/100 mL (20 °C)
1.27 g/100 mL (50 °C)
2.45 g/100 mL (100 °C)

| SolubleOther = insoluble in alcohol

| RefractIndex = 1.312

}}

| Section3 = {{Chembox Structure

| Structure_ref = {{cite journal|author=Allan Zalkin, J. D. Forrester, David H. Templeton|year=1964|volume=17|pages=1408–1412|doi=10.1107/S0365110X64003516|doi-access=free|journal=Acta Crystallographica|title=The Crystal Structure of Sodium Fluorosilicate|issue=11|bibcode=1964AcCry..17.1408Z }}

| CrystalStruct = trigonal

| SpaceGroup = P321

| LattConst_a = 8.859

| LattConst_c = 5.038

| UnitCellFormulas = 4

}}

|Section4={{Chembox Hazards

| NFPA-H = 2

| NFPA-F = 0

| NFPA-R = 0

| LDLo = 70 mg/kg (mouse, oral)
125 mg/kg (rabbit, oral){{IDLH|fluoride|Fluorides (as F)}}

}}

|Section7={{Chembox Related

| OtherCations = Ammonium hexafluorosilicate

Fluorosilicic acid}}

}}

Sodium fluorosilicate is a compound with the chemical formula Na₂[SiF₆]. Unlike other sodium salts, it has a low solubility in water.