Sodium hexafluoroantimonate
{{Chembox
| Name = Sodium hexafluoroantimonate
| ImageFile =
| ImageSize =
| ImageAlt =
| IUPACName = sodium;hexafluoroantimony(1-)
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 16925-25-0
| ChemSpiderID = 10626272
| UNII = 7JW6105AEM
| EINECS = 240-989-8
| PubChem = 16689647
| StdInChI = 1S/6FH.Na.Sb/h6*1H;;/q;;;;;;+1;+5/p-6
| StdInChIKey = HKLMYZVMEYYVBS-UHFFFAOYSA-H
| SMILES = F[Sb-](F)(F)(F)(F)F.[Na+]
}}
| Section2 = {{Chembox Properties
| Formula = {{chem2|NaSbF6}}
| MolarMass =
| Appearance = colorless crystals
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = soluble (slow hydrolysis)
}}
| Section3 = {{Chembox Hazards
| GHSPictograms = {{GHS07}}{{GHS09}}{{GHS03}}{{GHS06}}{{GHS08}}
| GHSSignalWord = Danger
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Sodium hexafluoroantimonate is an inorganic chemical compound with the chemical formula {{chem2|NaSbF6}}.{{cite web |title=Sodium hexafluoroantimonate, 98%, Thermo Scientific Chemicals {{!}} Fisher Scientific |url=https://www.fishersci.fi/shop/products/sodium-hexafluoroantimonate-98-thermo-scientific/10471713 |publisher=Fisher Scientific |access-date=14 June 2024}}{{cite web |title=Sodium hexafluoroantimonate(V) |url=https://www.sigmaaldrich.com/RU/en/product/aldrich/237981 |publisher=Sigma Aldrich |access-date=14 June 2024}}{{cite book |title=Toxic Substances Control Act (TSCA): PL 94-469 : Candidate List of Chemical Substances |date=1977 |publisher=Environmental Protection Agency, Office of Toxic Substances |page=1177 |url=https://books.google.com/books?id=RkN3mlTCcyEC&dq=sodium+hexafluoroantimonate&pg=PA1177 |access-date=14 June 2024 |language=en}}
Synthesis
Sodium hexafluoroantimonate may be synthesised by oxidation of antimony trioxide with bromine trifluoride:
::{{chem2|6Sb2O3 + 20BrF3 + 12NaF -> 12Na[SbF6] + 10Br2 + 9O2}}
Or it may be formed by reaction of antimony and sodium fluorides:
::{{chem2|SbF5 + NaF -> Na[SbF6]}}
Physical properties
Sodium hexafluoroantimonate forms colorless crystals, soluble in water.{{cite book |last1=Haynes |first1=William M. |title=CRC Handbook of Chemistry and Physics |date=22 June 2016 |publisher=CRC Press |isbn=978-1-4987-5429-3 |page=4-86 |url=https://books.google.com/books?id=VVezDAAAQBAJ&dq=sodium+hexafluoroantimonate&pg=SA4-PA86 |access-date=14 June 2024 |language=en}} It crystallizes in the cubic Pa3 space group with unit cell dimension of a=0.820 Å.
Chemical properties
Sodium hexafluoroantimonate undergoes slow partial hydrolysis in aqueous solutions.{{cite book |last1=Possart |first1=Wulff |title=Adhesion: Current Research and Applications |date=12 May 2006 |publisher=John Wiley & Sons |isbn=978-3-527-60710-5 |page=208 |url=https://books.google.com/books?id=jaDxT_wzohIC&dq=%22sodium+hexafluoroantimonate%22&pg=PA208 |access-date=14 June 2024 |language=en}}