Sodium hexafluorotitanate
{{Chembox
| Name = Sodium hexafluorotitanate
| ImageFile1 =
| ImageSize1 = 200px
| ImageFile2 =
| ImageSize2 = 200px
| IUPACName = disodium; hexafluorotitanium(2-)
| PIN =
| OtherNames = Disodium hexafluorotitanate, sodium fluotitanate(IV), sodium titanium fluoride
| Section1 = {{Chembox Identifiers
| CASNo = 17116-13-1
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 11221766
| ChEBI =
| DTXSID =
| EINECS = 241-181-8
| Gmelin =
| PubChem = 44717630
| SMILES = [Na+].[Na+].F[Ti-2](F)(F)(F)(F)F
| StdInChI= 1S/6FH.2Na.Ti/h6*1H;;;/q;;;;;;2*+1;+4/p-6
| StdInChIKey = HLJCWGPUCQTHFY-UHFFFAOYSA-H
}}
| Section2 = {{Chembox Properties
| Na=2 | Ti=1 | F=6
| Appearance = White powder
| Density =
| MeltingPtC = 146-156
| BoilingPtC =
| Solubility = soluble
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| GHSPictograms = {{GHS05}}{{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{HPhrases|H315|319|335}}
| PPhrases = {{PPhrases|262|280|305|351|338|304|340|403|233|501}}
}}
| Section6 = {{Chembox Related
| OtherCompounds =
}}
}}
Sodium hexafluorotitanate is an inorganic compound of sodium, fluorine, and titanium with the chemical formula {{chem2|Na2TiF6}}.{{cite web |title=Sodium Hexafluorotitanate(IV) |url=https://www.americanelements.com/sodium-hexafluorotitanate-iv-17116-13-1 |publisher=American Elements |access-date=14 February 2024 |language=en}}{{cite book |title=Toxic Substances Control Act (TSCA): PL 94-469 : Candidate List of Chemical Substances |date=1977 |publisher=Environmental Protection Agency, Office of Toxic Substances |page=1177 |url=https://books.google.com/books?id=RkN3mlTCcyEC&dq=Sodium+hexafluorotitanate&pg=PA1177 |access-date=14 February 2024 |language=en}}{{cite book |last1=Macintyre |first1=Jane E. |title=Dictionary of Inorganic Compounds |date=23 July 1992 |publisher=CRC Press |isbn=978-0-412-30120-9 |page=3235 |url=https://books.google.com/books?id=9eJvoNCSCRMC&dq=Sodium+hexafluorotitanate&pg=PA3235 |access-date=14 February 2024 |language=en}}
Physical properties
Hazards identification
The compound is severely irritating to skin, eyes, and respiratory tract. If it is inhaled or swallowed, the compound may cause fluoride poisoning.{{cite web |title=sodium hexafluorotitanate |url=https://www.chemsrc.com/en/cas/17116-13-1_955491.html |publisher=chemsrc.com |access-date=14 February 2024 |language=en}}
References
{{Reflist}}
{{Titanium compounds}}
{{Sodium compounds}}
{{Fluorine compounds}}