Strontium acetate

{{Chembox

| Reference = {{Cite web|url=https://www.chemicalbook.com/ChemicalProductProperty_EN_CB7336274.htm|title=STRONTIUM ACETATE | 543-94-2|website=www.chemicalbook.com}}{{Cite web|url=https://www.americanelements.com/strontium-acetate-543-94-2|title=Strontium Acetate|website=American Elements}}{{Cite web|url=http://www.chemspider.com/Chemical-Structure.10522.html|title=MFCD00036392 | C4H6O4Sr|website=ChemSpider}}

| Name = Strontium acetate

| IUPACName = Strontium acetate

| PIN =

| SystematicName =

| OtherNames = {{Unbulleted list

| Strontium(II) acetate

}}

| data page pagename =

| ImageFile = Strontium acetate.svg

| ImageSize =

| ImageAlt =

| ImageName =

| ImageCaption =

| ImageFile1 =

| ImageSize1 =

| ImageAlt1 =

| ImageName1 =

| ImageCaption1 =

| ImageFile2 =

| ImageSize2 =

| ImageAlt2 =

| ImageName2 =

| ImageCaption2 =

| ImageFile3 =

| ImageSize3 =

| ImageAlt3 =

| ImageName3 =

| ImageFileL1 =

| ImageSizeL1 =

| ImageAltL1 =

| ImageNameL1 =

| ImageFileR1 =

| ImageSizeR1 =

| ImageAltR1 =

| ImageNameR1 =

| ImageFileL2 =

| ImageSizeL2 =

| ImageAltL2 =

| ImageNameL2 =

| ImageFileR2 =

| ImageSizeR2 =

| ImageAltR2 =

| ImageNameR2 =

| Section1 = {{Chembox Identifiers

| 3DMet =

| Abbreviations =

| Beilstein =

| CASNo = 543-94-2

| CASNo_Comment =

| ChEBI =

| ChemSpiderID = 10522

| Gmelin =

| KEGG =

| MeSHName =

| PubChem = 10987

| EC_number = 208-854-8

| RTECS = AJ4725000

| UNII = 4SL32YMY7B

| StdInChI=1S/2C2H4O2.Sr/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2

| StdInChIKey = RXSHXLOMRZJCLB-UHFFFAOYSA-L

| SMILES = CC(=O)[O-].CC(=O)[O-].[Sr+2]

}}

| Section2 = {{Chembox Properties

| AtmosphericOHRateConstant =

| Appearance = White crystals

| BoilingPt =

| BoilingPtC =

| BoilingPt_ref =

| BoilingPt_notes =

| Density = 2.099 g/cm³

| Formula = Sr(C₂H₄O₂)₂

| HenryConstant =

| LogP = −1.122

| MolarMass = 205.932 g/mol

| MeltingPt =

| MeltingPtC = 150

| MeltingPt_ref =

| MeltingPt_notes =

| pKa =

| pKb =

| Solubility = Soluble

| SolubleOther =

| Solvent =

| VaporPressure =

}}

| Section3 = {{Chembox Structure

| Coordination =

| CrystalStruct =

| MolShape =

}}

| Section4 = {{Chembox Thermochemistry

| DeltaGf =

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity =

}}

| Section5 = {{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

| Section6 = {{Chembox Pharmacology

| ATCvet =

| ATCCode_prefix =

| ATCCode_suffix =

| ATC_Supplemental =

| AdminRoutes =

| Bioavail =

| Excretion =

| HalfLife =

| Metabolism =

| Legal_status =

| Legal_AU =

| Legal_AU_comment =

| Legal_CA =

| Legal_CA_comment =

| Legal_NZ =

| Legal_NZ_comment =

| Legal_US =

| Legal_US_comment =

| Legal_UK =

| Legal_UK_comment =

| Legal_EU =

| Legal_EU_comment =

| Legal_UN =

| Legal_UN_comment =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_AU_comment =

| ProteinBound =

| Dependence_liability =

| Addiction_liability =

}}

| Section7 = {{Chembox Hazards

| AutoignitionPt =

| ExploLimits =

| FlashPt = Not flammable

| LD50 =

| LC50 =

| MainHazards =

| NFPA-F = 0

| NFPA-H = 1

| NFPA-R = 1

| NFPA-S =

| PEL =

| REL =

| ExternalSDS =

| GHSPictograms =

| GHSSignalWord =

| HPhrases =

| PPhrases =

}}

| Section9 = {{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Strontium acetate is a compound of strontium. It is a white solid and is soluble in water like other acetates. It is used as a pathway for other chemicals such as barium acetate. Additionally, it is used in some strontium-containing toothpastes.{{Cite web |title=Pictures, stories, and facts about the element Strontium in the Periodic Table |url=https://periodictable.com/Elements/038/index.html |access-date=2024-11-02 |website=periodictable.com}}