TDI-11861

{{Short description|Chemical compound}}

{{drugbox

| drug_name = TDI-11861

| image = TDI-11861_structure.png

| legal_UK =

| legal_DE =

| C = 22 | H = 25 | Cl = 1 | F = 2 | N = 6 | O = 3

| IUPAC_name = [(3R)-4-[2-[2-[[3-(2-amino-6-chloropyrimidin-4-yl)-1-(difluoromethyl)pyrazol-4-yl]methyl]phenoxy]ethyl]morpholin-3-yl]methanol

| CAS_number = 2857049-72-8

| CAS_supplemental =

| ChemSpiderID =

| PubChem = 166101565

| smiles = C1COC[C@H](N1CCOC2=CC=CC=C2CC3=CN(N=C3C4=CC(=NC(=N4)N)Cl)C(F)F)CO

| StdInChI = 1S/C22H25ClF2N6O3/c23-19-10-17(27-22(26)28-19)20-15(11-31(29-20)21(24)25)9-14-3-1-2-4-18(14)34-8-6-30-5-7-33-13-16(30)12-32/h1-4,10-11,16,21,32H,5-9,12-13H2,(H2,26,27,28)/t16-/m1/s1

| StdInChIKey = XVGSKZXXLKUEIO-MRXNPFEDSA-N

}}

TDI-11861 is a chemical compound which acts as a potent {{cite journal | vauthors = Rossetti T, Ferreira J, Ghanem L, Buck H, Steegborn C, Myers RW, Meinke PT, Levin LR, Buck J | display-authors = 6 | title = Assessing potency and binding kinetics of soluble adenylyl cyclase (sAC) inhibitors to maximize therapeutic potential | journal = Frontiers in Physiology | volume = 13 | pages = 1013845 | date = 28 September 2022 | pmid = 36246105 | pmc = 9554468 | doi = 10.3389/fphys.2022.1013845 | doi-access = free }} and selective inhibitor of soluble adenylyl cyclase (sAC).{{cite journal | vauthors = Miller M, Rossetti T, Ferreira J, Ghanem L, Balbach M, Kaur N, Levin LR, Buck J, Kehr M, Coquille S, van den Heuvel J, Steegborn C, Fushimi M, Finkin-Groner E, Myers RW, Kargman S, Liverton NJ, Huggins DJ, Meinke PT | display-authors = 6 | title = Design, Synthesis, and Pharmacological Evaluation of Second-Generation Soluble Adenylyl Cyclase (sAC, ADCY10) Inhibitors with Slow Dissociation Rates | journal = Journal of Medicinal Chemistry | volume = 65 | issue = 22 | pages = 15208–15226 | date = November 2022 | pmid = 36346696 | pmc = 9866367 | doi = 10.1021/acs.jmedchem.2c01133 | s2cid = 253395810 }} In animal studies it reversibly inhibits sperm motility, producing temporary infertility without hormonal side effects. While TDI-11861 is at an early developmental stage and is unlikely to be developed for medical uses in humans itself, it represents an important proof of concept which may potentially lead to the development of future male contraceptive drugs.{{cite journal | vauthors = Balbach M, Rossetti T, Ferreira J, Ghanem L, Ritagliati C, Myers RW, Huggins DJ, Steegborn C, Miranda IC, Meinke PT, Buck J, Levin LR | display-authors = 6 | title = On-demand male contraception via acute inhibition of soluble adenylyl cyclase | journal = Nature Communications | volume = 14 | issue = 1 | pages = 637 | date = February 2023 | pmid = 36788210 | pmc = 9929232 | doi = 10.1038/s41467-023-36119-6 | bibcode = 2023NatCo..14..637B }}{{cite patent | url = https://patents.google.com/patent/WO2022232259A1/en?oq=WO2022232259 | inventor = Balbach M, et al. | title = Soluble Adenylyl Cyclase (sAC) Inhibitors and Uses Thereof | country = WO | number = 2022/232259 | assign1 = Cornell University | assign2 = Tri-Institutional Therapeutics Discovery Institute, Inc. | pubdate = 3 November 2022 }}

See also

References