CDD-2807

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{drugbox

| drug_name = CDD-2807

| image = CDD-2807_structure.png

| legal_UK =

| legal_DE =

| C = 29 | H = 26 | N = 4 | O = 1

| IUPAC_name = (3-([1,1'-Biphenyl]-2-ylethynyl)-1H-indazol-5-yl)(2,6-diazaspiro[3.5]nonan-2-yl)methanone

| CAS_number =

| CAS_supplemental =

| ChemSpiderID =

| PubChem =

| smiles = O=C(N1CC2(C1)CNCCC2)c1cc2c([NH]nc2C#Cc2ccccc2c2ccccc2)cc1

| StdInChI = 1S/C29H26N4O/c34-28(33-19-29(20-33)15-6-16-30-18-29)23-12-14-27-25(17-23)26(31-32-27)13-11-22-9-4-5-10-24(22)21-7-2-1-3-8-21/h1-5,7-10,12,14,17,30H,6,15-16,18-20H2,(H,31,32)

| StdInChIKey = YXMAOKMVGOSRPS-UHFFFAOYSA-N

}}

CDD-2807 is a chemical compound which acts as a potent and selective inhibitor of serine/threonine-protein kinase 33 (STK33), with a IC50 of 9.2 nM. In animal studies it causes production of abnormal sperm with reduced motility, and it has been investigated as a potential male contraceptive drug.{{cite journal | vauthors = Holdaway J, Georg GI | title = An emerging target for male contraception | journal = Science | volume = 384 | issue = 6698 | pages = 849–850 | date = May 2024 | pmid = 38781397 | doi = 10.1126/science.adp6432 | bibcode = 2024Sci...384..849H }}{{cite journal | vauthors = Ku AF, Sharma KL, Ta HM, Sutton CM, Bohren KM, Wang Y, Chamakuri S, Chen R, Hakenjos JM, Jimmidi R, Kent K, Li F, Li JY, Ma L, Madasu C, Palaniappan M, Palmer SS, Qin X, Robers MB, Sankaran B, Tan Z, Vasquez YM, Wang J, Wilkinson J, Yu Z, Ye Q, Young DW, Teng M, Kim C, Matzuk MM | title = Reversible male contraception by targeted inhibition of serine/threonine kinase 33 | journal = Science | volume = 384 | issue = 6698 | pages = 885–890 | date = May 2024 | pmid = 38781365 | doi = 10.1126/science.adl2688 | bibcode = 2024Sci...384..885K | pmc = 11842024 }}

See also

References