Taxadiene

{{Chembox

| ImageFile = taxadiene.svg

| ImageSize = 200px

| IUPACName = Taxa-4,11-diene

| SystematicName = (4aS,6S,12aS)-4,9,12a-Trimethyl-1,2,4a,5,6,7,8,11,12,12a-decahydro-6,10-methanobenzo[10]annulene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 163594-75-0

| PubChem = 443484

| ChemSpiderID = 391697

| SMILES = C\1(=C2/CC[C@]3(C)CC/C=C(/C)[C@H]3C[C@H](CC/1)C2(C)C)C

| InChI = 1/C20H32/c1-14-7-6-11-20(5)12-10-17-15(2)8-9-16(13-18(14)20)19(17,3)4/h7,16,18H,6,8-13H2,1-5H3/t16-,18+,20-/m0/s1

| InChIKey = FRJSECSOXKQMOD-HQRMLTQVBK

| StdInChI = 1S/C20H32/c1-14-7-6-11-20(5)12-10-17-15(2)8-9-16(13-18(14)20)19(17,3)4/h7,16,18H,6,8-13H2,1-5H3/t16-,18+,20-/m0/s1

| StdInChIKey = FRJSECSOXKQMOD-HQRMLTQVSA-N

}}

|Section2={{Chembox Properties

| C=20 | H=32

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Taxadiene (taxa-4,11-diene) is a diterpene. Taxadiene is the first committed intermediate in the synthesis of taxol. Six hydroxylation reactions, and a few others, are needed to convert taxadiene to baccatin III.

Enzymatically, taxadiene is produced from geranylgeranyl pyrophosphate by taxadiene synthase. A biochemical gram-scale production of taxadiene has been reported in 2010 using genetically engineered Escherichia coli.

References

{{Reflist|2|refs=

{{Cite journal | doi = 10.1021/bi9526239 | title = Mechanism of Taxadiene Synthase, a Diterpene Cyclase That Catalyzes the First Step of Taxol Biosynthesis in Pacific Yew† | year = 1996 | last1 = Lin | first1 = Xiaoyan | last2 = Hezari | first2 = Mehri | last3 = Koepp | first3 = Alfred E. | last4 = Floss | first4 = Heinz G. | last5 = Croteau | first5 = Rodney | journal = Biochemistry | volume = 35 | issue = 9 | pages = 2968–77 | pmid = 8608134}}

{{cite journal |vauthors=Ajikumar PK, Xiao WH, Tyo KE, Wang Y, Simeon F, Leonard E, etal | title=Isoprenoid pathway optimization for Taxol precursor overproduction in Escherichia coli. | journal=Science | year= 2010 | volume= 330 | issue= 6000 | pages= 70–4 | pmid=20929806 | doi=10.1126/science.1191652 | pmc=3034138 | bibcode=2010Sci...330...70A | url=http://dspace.mit.edu/bitstream/1721.1/81256/1/Stephanopoulos_Isoprenoid%20pathway.pdf }}

}}

Category:Dienes

Category:Taxanes

Category:Diterpenes

{{pharma-stub}}

{{Ether-stub}}