Template:Infobox drug/testcases/warning

{{Testcase table

| _template = Infobox drug

| Watchedfields = changed

| verifiedrevid = 456349142

| drug_name = Paracetamol

| INN =

| type =

| image = Paracetamol-skeletal.svg

| width =

| alt =

| caption =

| image2 = Paracetamol-from-xtal-3D-balls.png

| width2 =

| alt2 =

| USAN = acetaminophen

| pronounce = Paracetamol: {{IPAc-en|ˌ|p|ær|ə|ˈ|s|iː|t|ə|m|ɒ|l}}
Acetaminophen: {{IPAc-en|audio=En-acetaminophen.oga|ə|ˌ|s|iː|t|ə|ˈ|m|ɪ|n|ə|f|ɪ|n}}

| tradename = Tylenol, Panadol, others{{drugs.com|international| acetaminophen}}

| Drugs.com = {{drugs.com|monograph|acetaminophen}}

| MedlinePlus = a681004

| licence_CA =

| licence_EU =

| DailyMedID = Acetaminophen

| licence_US = Acetaminophen

| pregnancy_AU = A

| pregnancy_AU_comment = {{cite web |title=Acetaminophen Use During Pregnancy |website=Drugs.com |date=14 June 2019 |url=https://www.drugs.com/pregnancy/acetaminophen.html |access-date=25 February 2020 |archive-date=9 March 2020 |archive-url=https://web.archive.org/web/20200309154313/https://www.drugs.com/pregnancy/acetaminophen.html |url-status=live }}

| pregnancy_category =

| routes_of_administration = Oral (by mouth), rectal, intravenous (IV)

| class = Analgesics and antipyretics

| ATCvet =

| ATC_prefix = N02

| ATC_suffix = BE01

| ATC_supplemental = {{ATC|N02|BE51}} {{ATC|N02|BE71}}

| legal_AU = S4 (Rx), OTC, and unscheduled

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA = OTC

| legal_CA_comment = / Rx-only{{cite web |url=https://hpr-rps.hres.ca/reg-content/regulatory-decision-summary-detail.php?lang=en&linkID=RDS00565 |title=Regulatory Decision Summary – Acetaminophen Injection |website=Health Canada |date=23 October 2014 |access-date=7 June 2022 |archive-date=7 June 2022 |archive-url=https://web.archive.org/web/20220607080419/https://hpr-rps.hres.ca/reg-content/regulatory-decision-summary-detail.php?lang=en&linkID=RDS00565 |url-status=live }}

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK = GSL

| legal_UK_comment =

| legal_US = OTC

| legal_US_comment = / Rx-only

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability = 63–89%{{cite book |isbn=978-0-9873236-7-5 |title=Acute Pain Management: Scientific Evidence |veditors=Schug SA, Palmer GM, Scott DA, Halliwell R, Trinca J |vauthors=((Working Group of the Australian and New Zealand College of Anaesthetists and Faculty of Pain Medicine)) |year=2015 |edition=4th |publisher=Australian and New Zealand College of Anaesthetists (ANZCA), Faculty of Pain Medicine (FPM) |location=Melbourne |url=http://fpm.anzca.edu.au/documents/apmse4_2015_final |format=PDF |access-date=28 October 2019 |archive-url=https://web.archive.org/web/20190731120330/http://fpm.anzca.edu.au/documents/apmse4_2015_final |archive-date=31 July 2019 |url-status=dead }}{{rp|73}}

| protein_bound = negligible to 10–25% in overdose{{cite journal |vauthors=Forrest JA, Clements JA, Prescott LF |title=Clinical pharmacokinetics of paracetamol |journal=Clin Pharmacokinet |volume=7 |issue=2 |pages=93–107 |date=1982 |pmid=7039926 |doi=10.2165/00003088-198207020-00001 |s2cid=20946160}}

| metabolism = Predominantly in the liver{{cite web|title=Codapane Forte Paracetamol and codeine phosphate product information|work=TGA eBusiness Services|publisher=Alphapharm Pty Limited|date=29 April 2013|access-date=10 May 2014|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-05623-3|format=PDF|archive-date=6 February 2016|archive-url=https://web.archive.org/web/20160206163239/https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-05623-3|url-status=live}}

| metabolites = APAP gluc, APAP sulfate, APAP GSH, APAP cys, AM404, NAPQI{{cite web |title= Acetaminophen Pathway (therapeutic doses), Pharmacokinetics |url= https://www.pharmgkb.org/pathway/PA165986279 |access-date= 13 January 2016 |url-status= dead |archive-url= https://web.archive.org/web/20160304220600/https://www.pharmgkb.org/pathway/PA165986279 |archive-date= 4 March 2016 }}

| onset = Pain relief onset by route:
oral{{nbsp}}– 37{{nbsp}}minutes{{cite journal |vauthors = Pickering G, Macian N, Libert F, Cardot JM, Coissard S, Perovitch P, Maury M, Dubray C |title = Buccal acetaminophen provides fast analgesia: two randomized clinical trials in healthy volunteers |journal = Drug Design, Development and Therapy| volume = 8 |pages = 1621–1627 |date = September 2014 |pmid = 25302017 |pmc = 4189711 |doi = 10.2147/DDDT.S63476 |quote = In postoperative conditions for acute pain of mild to moderate intensity, the quickest reported time to onset of analgesia with APAP is 8 minutes9 for the iv route and 37 minutes6 for the oral route. |doi-access = free }}
Intravenous{{nbsp}}– 8{{nbsp}}minutes

| elimination_half-life = 1.9–2.5 hours

| duration_of_action =

| excretion = Urine

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 103-90-2

| CAS_supplemental =

| PubChem = 1983

| PubChemSubstance = 46506142

| IUPHAR_ligand = 5239

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00316

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 1906

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 362O9ITL9D

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00217

| KEGG2 = C06804

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 46195

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 112

| NIAID_ChemDB =

| PDB_ligand = TYL

| synonyms = N-acetyl-para-aminophenol (APAP)

| IUPAC_name = N-(4-hydroxyphenyl)acetamide

| C = 8

| H = 9

| N = 1

| O = 2

| SMILES = CC(=O)Nc1ccc(O)cc1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)

| StdInChI_comment =

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RZVAJINKPMORJF-UHFFFAOYSA-N

| density = 1.263

| density_notes =

| melting_point = 169

| melting_high =

| melting_notes = {{Cite journal |doi = 10.1021/ci0500132 |title = General Melting Point Prediction Based on a Diverse Compound Data Set and Artificial Neural Networks |year = 2005 |vauthors=Karthikeyan M, Glen RC, Bender A |journal = Journal of Chemical Information and Modeling |volume = 45 |issue = 3 |pages = 581–590 |pmid = 15921448}}{{cite web |url = http://lxsrv7.oru.edu/~alang/meltingpoints/meltingpointof.php?csid=1906 |title = melting point data for paracetamol |publisher = Lxsrv7.oru.edu |access-date = 19 March 2011 |url-status = dead |archive-url = https://archive.today/20120630213835/http://lxsrv7.oru.edu/~alang/meltingpoints/meltingpointof.php?csid=1906 |archive-date = 30 June 2012 }}

| boiling_point =

| boiling_notes =

| solubility = {{ubl| 7.21{{nbsp}}g/kg (0{{nbsp}}°C){{cite journal| doi = 10.1021/je990124v| title = Solubility of paracetamol in pure solvents| vauthors=Granberg RA, Rasmuson AC| journal = Journal of Chemical & Engineering Data| volume = 44 |issue = 6 |pages = 1391–95| year = 1999}}| 8.21{{nbsp}}g/kg (5{{nbsp}}°C)| 9.44{{nbsp}}g/kg (10{{nbsp}}°C)| 10.97{{nbsp}}g/kg (15{{nbsp}}°C)| 12.78{{nbsp}}g/kg (20{{nbsp}}°C)| ~14{{nbsp}}mg/ml (20{{nbsp}}°C)}}

| sol_units =

| specific_rotation =

}}

{{Section references}}

{{Testcase table

| _template = Infobox drug

| drug_name = Brincidofovir

| image = Brincidofovir structure.svg

| alt =

| caption =

| pronounce =

| tradename = Tembexa

| Drugs.com =

| MedlinePlus =

| licence_EU =

| DailyMedID = Brincidofovir

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration = By mouth

| class =

| ATCvet =

| ATC_prefix = J05

| ATC_suffix = AB17

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=FDA approves drug to treat smallpox | website=U.S. Food and Drug Administration (FDA) | date=4 June 2021 | url=https://www.fda.gov/drugs/drug-safety-and-availability/fda-approves-drug-treat-smallpox | access-date=7 June 2021 | archive-date=8 June 2021 | archive-url=https://web.archive.org/web/20210608011633/https://www.fda.gov/drugs/drug-safety-and-availability/fda-approves-drug-treat-smallpox | url-status=live }} {{PD-notice}}

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| index2_label = Sodium salt

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 444805-28-1

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 496765-79-8

| CAS_supplemental =

| PubChem = 483477

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank = DB12151

| DrugBank2 = DBSALT002145

| ChemSpiderID_Ref =

| ChemSpiderID = 424003

| ChemSpiderID2 = 21259112

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6794O900AX

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 8UN8SA9Z5C

| KEGG_Ref =

| KEGG = D10547

| ChEBI_Ref =

| ChEBI =

| ChEMBL_Ref =

| ChEMBL = 203321

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = CMX001; Cidofovir-HDP; hexadecyloxypropyl-cidofovir

| IUPAC_name = ({[(2S)-1-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3-hydroxypropan-2-yl]oxy}methyl)[3-(hexadecyloxy)propoxy]phosphinic acid

| C=27 | H=52 | N=3 | O=7 | P=1

| SMILES = CCCCCCCCCCCCCCCCOCCCOP(=O)(O)CO[C@H](CO)Cn1ccc(N)nc1=O

| StdInChI = 1S/C27H52N3O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-35-20-16-21-37-38(33,34)24-36-25(23-31)22-30-18-17-26(28)29-27(30)32/h17-18,25,31H,2-16,19-24H2,1H3,(H,33,34)(H2,28,29,32)/t25-/m0/s1

| StdInChI_comment =

| StdInChIKey = WXJFKKQWPMNTIM-VWLOTQADSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

{{Section references}}

{{Testcase table

| _template = Infobox drug

| Watchedfields = changed

| verifiedrevid = 477316402

| drug_name = Albendazole

| IUPAC_name = Methyl [5-(propylthio)-1H-benzoimidazol-2-yl]carbamate

| image = Albendazole.svg

| image2 = Albendazole-from-xtal-2007-3D-balls.png

| width2 = 250

| tradename = Albenza, Valbazen, Zentel, others

| Drugs.com = {{drugs.com|monograph|albendazole}}

| MedlinePlus = a610019

| DailyMedID = Albendazole

| pregnancy_AU = D

| routes_of_administration = By mouth

| legal_AU = S4

| legal_CA = Rx-only

| legal_UK = POM

| legal_US = Rx-only

| legal_US_comment = (for humans; veterinary suspension and paste are both OTC){{cite book | vauthors = Plumb DC | title=Plumb's Veterinary Drug Handbook | chapter=Albendazole | location=Stockholm, Wisconsin; Ames, Iowa | date=2011 | edition=7th | publisher=Wiley | isbn=978-0-470-95964-0 | pages=19–21}}

| bioavailability = <5%{{cite web|title=Albenza, (albendazole) dosing, indications, interactions, adverse effects, and more|work=Medscape Reference|publisher=WebMD|access-date=February 25, 2014|url=http://reference.medscape.com/drug/albenza-albendazole-342648#showall|url-status=live|archive-url=https://web.archive.org/web/20140301073400/http://reference.medscape.com/drug/albenza-albendazole-342648#showall|archive-date=March 1, 2014}}

| protein_bound = 70%

| metabolism = Hepatic

| elimination_half-life = 8-12 hours

| excretion = Bile (humans)
Urine (ruminants)

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 54965-21-8

| ATC_prefix = P02

| ATC_suffix = CA03

| ATC_supplemental = {{ATCvet|P52|AC11}}

| PubChem = 2082

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00518

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 1998

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F4216019LN

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00134

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16664

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1483

| NIAID_ChemDB = 007895

| C=12 | H=15 | N=3 | O=2 | S=1

| smiles = CCCSc2ccc1nc(NC(=O)OC)[nH]c1c2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H15N3O2S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HXHWSAZORRCQMX-UHFFFAOYSA-N

| melting_point = 208

| melting_high = 210

}}

{{Section references}}