Testosterone valerate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,10R,13S,14S,17S)-10,13-Dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] pentanoate

| image = Testosterone valerate.svg

| width = 250px

| image2 = Testosterone valerate molecule ball.png

| width2 = 250px

| tradename = Deposterona

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 3129-43-9

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 102373

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 92468

| UNII = 7SF23403A0

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = Testosterone pentanoate; Testosterone 17β-valerate; Androst-4-en-17β-ol-3-one 17β-valerate

| C=24 | H=36 | O=3

| SMILES = CCCCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C

| StdInChI_Ref =

| StdInChI = 1S/C24H36O3/c1-4-5-6-22(26)27-21-10-9-19-18-8-7-16-15-17(25)11-13-23(16,2)20(18)12-14-24(19,21)3/h15,18-21H,4-14H2,1-3H3/t18-,19-,20-,21-,23-,24-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = UCNQPYVHDCHENM-CGRIZKAYSA-N

}}

Testosterone valerate, or testosterone pentanoate, also known as androst-4-en-17β-ol-3-one 17β-valerate, is a synthetic, steroidal androgen and an androgen ester – specifically, the C17β valerate ester of testosterone – which is used in veterinary medicine.{{cite book| vauthors = Llewellyn W |title=Anabolics|url=https://books.google.com/books?id=afKLA-6wW0oC&pg=PT437|year=2011|publisher=Molecular Nutrition Llc|isbn=978-0-9828280-1-4|pages=437–}} It is administered via intramuscular injection and acts as a long-lasting prodrug of testosterone. The medication is available as a component of the veterinary drug Deposterona, which is marketed in Mexico and also contains testosterone acetate and testosterone undecanoate. Testosterone valerate is a short-to-medium duration ester of testosterone, with an elimination half-life of approximately twice that of the short-acting testosterone propionate.