Tetrindole

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451925145

| IUPAC_name = 2,3,3a,4,5,6-Hexahydro-8-cyclohexyl-1H-pyrazino[3,2,1-j,k]carbazole

| image = Tetrindole skeletal.svg

| width = 110

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|PubChem}}

| CAS_number = 170964-67-7

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 160020

| ChemSpiderID =140675

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 77799

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII = 978VSV87L6

| ChEMBL = 4303571

| C=20 | H=26 | N=2

| smiles = C1CCC(CC1)C2=CC3=C(C=C2)N4CCNC5C4=C3CCC5

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H26N2/c1-2-5-14(6-3-1)15-9-10-19-17(13-15)16-7-4-8-18-20(16)22(19)12-11-21-18/h9-10,13-14,18,21H,1-8,11-12H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AUXCHYJDVJZEPG-UHFFFAOYSA-N

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

}}

Tetrindole was a drug candidate that functions by reversibly inhibiting monoamine oxidase A; it was first synthesized in Moscow in the early 1990s.{{cite journal | vauthors = Medvedev AE, Kirkel AA, Kamyshanskaya NS, Moskvitina TA, Axenova LN, Gorkin VZ, Andreeva NI, Golovina SM, Mashkovsky MD | display-authors = 6 | title = Monoamine oxidase inhibition by novel antidepressant tetrindole | journal = Biochemical Pharmacology | volume = 47 | issue = 2 | pages = 303–8 | date = January 1994 | pmid = 8304974 | doi = 10.1016/0006-2952(94)90021-3 }} Tetrindole is similar in its chemical structure to pirlindole (Pyrazidol), and metralindole.{{cite journal | vauthors = Ramsay RR, Gravestock MB | title = Monoamine oxidases: to inhibit or not to inhibit | journal = Mini Reviews in Medicinal Chemistry | volume = 3 | issue = 2 | pages = 129–36 | date = March 2003 | pmid = 12570845 | doi = 10.2174/1389557033405287 }}