metralindole

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2,4,5,6-tetrahydro-9-methoxy-4-methyl-1H-3,4,6a-triazafluoranthene

| image = Metralindole structure.svg

| width = 100

| tradename =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| index2_label = HCl

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 53734-79-5

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = M15TM76Y3L

| CAS_number = 54188-38-4

| ATC_prefix = none

| ATC_suffix =

| PubChem = 68713

| ChemSpiderID = 61964

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2QW3FL6OPA

| C=15 | H=17 | N=3 | O=1

| smiles = CN1CCN2C3=C(C=C(C=C3)OC)C4=C2C1=NCC4

}}

Metralindole (Inkazan) is a reversible inhibitor of monoamine oxidase A (RIMA) which was investigated in Russia as a potential antidepressant.{{cite journal | vauthors = Andreeva NI, Golovina SM, Faermark MF, Shvarts GI, Mashkovskiĭ MD | title = [The comparative influence of pyrazidol, inkazan and other antidepressant monoamine oxidase inhibitors on the pressor effect of tyramine] | language = ru | journal = Farmakologiia i Toksikologiia | volume = 54 | issue = 2 | pages = 38–40 | year = 1991 | pmid = 1884793 }} It is structurally and pharmacologically related to pirlindole.