Thiamine pyrophosphate
{{chembox
| Watchedfields = changed
| verifiedrevid = 470606241
| Name =
| ImageFile = Thiamine diphosphate.png
| ImageClass = skin-invert-image
| ImageSize = 200px
| IUPACName = 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate
| OtherNames = Thiamine diphosphate
| SystematicName =
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10670483
| ChEBI = 9532
| KEGG = C00068
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q57971654Y
| InChI = 1/C12H17N4OS.ClH.H4O7P2/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;1-8(2,3)7-9(4,5)6/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H;(H2,1,2,3)(H2,4,5,6)/q+1;;/p-1
| InChIKey = NBSUTVXQOGUTJX-REWHXWOFAB
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H17N4OS.ClH.H4O7P2/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;1-8(2,3)7-9(4,5)6/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H;(H2,1,2,3)(H2,4,5,6)/q+1;;/p-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NBSUTVXQOGUTJX-UHFFFAOYSA-M
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 136-08-3
| PubChem = 1132
| SMILES = Cc2ncc(C[n+]1csc(CCOP(=O)(O)OP(=O)(O)O)c1C)c(N)n2
| MeSHName = Thiamine+pyrophosphate
}}
| Section2 = {{Chembox Properties
| Formula = C12H19N4O7P2S+
| MolarMass = 425.314382 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
| Section4 =
| Section5 =
| Section6 =
}}
Thiamine pyrophosphate (TPP or ThPP), or thiamine diphosphate (ThDP), or cocarboxylase{{cite journal | vauthors = Pietrzak I | title = [Vitamin disturbances in chronic renal insufficiency. I. Water soluble vitamins] | language = pl | journal = Przegla̧d Lekarski | volume = 52 | issue = 10 | pages = 522–5 | year = 1995 | pmid = 8834846 }} is a thiamine (vitamin B1) derivative which is produced by the enzyme thiamine diphosphokinase. Thiamine pyrophosphate is a cofactor that is present in all living systems, in which it catalyzes several biochemical reactions.
Thiamine pyrophosphate is synthesized in the cytosol and is required in the cytosol for the activity of transketolase and in the mitochondria for the activity of pyruvate-, oxoglutarate- and branched chain keto acid dehydrogenases. To date, the yeast ThPP carrier (Tpc1p) the human Tpc and the Drosophila melanogaster have been identified as being responsible for the mitochondrial transport of ThPP and ThMP.{{Cite journal|last1=Marobbio|first1=C. M. T.|last2=Vozza|first2=A.|last3=Harding|first3=M.|last4=Bisaccia|first4=F.|last5=Palmieri|first5=F.|last6=Walker|first6=J. E.|date=2002-11-01|title=Identification and reconstitution of the yeast mitochondrial transporter for thiamine pyrophosphate|url= |journal=The EMBO Journal|language=en|volume=21|issue=21|pages=5653–5661|doi=10.1093/emboj/cdf583|issn=0261-4189|pmc=131080|pmid=12411483}}{{Cite journal|last1=Iacopetta|first1=Domenico|last2=Carrisi|first2=Chiara|last3=De Filippis|first3=Giuseppina|last4=Calcagnile|first4=Valeria M.|last5=Cappello|first5=Anna R.|last6=Chimento|first6=Adele|last7=Curcio|first7=Rosita|last8=Santoro|first8=Antonella|last9=Vozza|first9=Angelo|date=2010-03-01|title=The biochemical properties of the mitochondrial thiamine pyrophosphate carrier from Drosophila melanogaster|journal=FEBS Journal|language=en|volume=277|issue=5|pages=1172–1181|doi=10.1111/j.1742-4658.2009.07550.x|issn=1742-4658|pmid=20121944|doi-access=free}}{{Cite journal|last1=Lindhurst|first1=Marjorie J.|last2=Fiermonte|first2=Giuseppe|last3=Song|first3=Shiwei|last4=Struys|first4=Eduard|last5=Leonardis|first5=Francesco De|last6=Schwartzberg|first6=Pamela L.|last7=Chen|first7=Amy|last8=Castegna|first8=Alessandra|last9=Verhoeven|first9=Nanda|date=2006-10-24|title=Knockout of Slc25a19 causes mitochondrial thiamine pyrophosphate depletion, embryonic lethality, CNS malformations, and anemia|journal=Proceedings of the National Academy of Sciences|language=en|volume=103|issue=43|pages=15927–15932|doi=10.1073/pnas.0607661103|issn=0027-8424|pmc=1595310|pmid=17035501|bibcode=2006PNAS..10315927L|doi-access=free}} It was first discovered as an essential nutrient (vitamin) in humans through its link with the peripheral nervous system disease beriberi, which results from a deficiency of thiamine in the diet.{{cite book | author = Pavia, Donald L., Gary M. Lampman, George S. Kritz, Randall G. Engel | title = Introduction to Organic Laboratory Techniques (4th Ed.) | publisher = Thomson Brooks/Cole| pages = 304–5 | year = 2006 | isbn = 978-0-495-28069-9}}
TPP works as a coenzyme in many enzymatic reactions, such as:
- Pyruvate dehydrogenase complex{{cite web|url=http://chemistry.gsu.edu/Glactone/PDB/Proteins/Krebs/1pyd.html|title=PDBs for Biochemistry|publisher=Georgia State University|access-date=2009-02-07|url-status=dead|archive-url=https://web.archive.org/web/20110716103545/http://chemistry.gsu.edu/Glactone/PDB/Proteins/Krebs/1pyd.html|archive-date=2011-07-16}}
- Pyruvate decarboxylase in ethanol fermentation
- Alpha-ketoglutarate dehydrogenase complex
- Branched-chain amino acid dehydrogenase complex
- 2-hydroxyphytanoyl-CoA lyase
- Transketolase
Chemistry
Chemically, TPP consists of a pyrimidine ring which is connected to a thiazole ring, which is in turn connected to a pyrophosphate (diphosphate) functional group.
The part of TPP molecule that is most commonly involved in reactions is the thiazole ring, which contains nitrogen and sulfur. Thus, the thiazole ring is the "reagent portion" of the molecule. The C2 of this ring is capable of acting as an acid by donating its proton and forming a carbanion.{{Citation|last1=Begley|first1=Tadhg P.|title=7.15 - Thiamin Biosynthesis|date=2010-01-01|url=http://www.sciencedirect.com/science/article/pii/B9780080453828001489|work=Comprehensive Natural Products II|pages=547–559|editor-last=Liu|editor-first=Hung-Wen (Ben)|place=Oxford|publisher=Elsevier|language=en|doi=10.1016/b978-008045382-8.00148-9|isbn=978-0-08-045382-8|access-date=2020-12-16|last2=Ealick|first2=Steven E.|editor2-last=Mander|editor2-first=Lew|url-access=subscription}} Normally, reactions that form carbanions are highly unfavorable, but the positive charge on the tetravalent nitrogen just adjacent to the carbanion stabilizes the negative charge, making the reaction much more favorable. A compound with positive and negative charges on adjacent atoms is called an ylide, so sometimes the carbanion form of TPP is referred to as the "ylide form".{{cite book |title= Fundamentals of Biochemistry |url= https://archive.org/details/fundamentalsbioc00voet |url-access= limited |last= Voet |first= Donald |author2=Judith Voet |author3=Charlotte Pratt |year= 2008 |publisher= John Wiley & Sons Inc |isbn=978-0-470-12930-2 |page=[https://archive.org/details/fundamentalsbioc00voet/page/n538 508]}}
Reaction mechanisms
In several reactions, including that of pyruvate dehydrogenase, alpha-ketoglutarate dehydrogenase, and transketolase, TPP catalyses the reversible decarboxylation reaction (aka cleavage of a substrate compound at a carbon-carbon bond connecting a carbonyl group to an adjacent reactive group—usually a carboxylic acid or an alcohol). It achieves this in four basic steps:
- The carbanion of the TPP ylid nucleophilically attacks the carbonyl group on the substrate. (This forms a single bond between the TPP and the substrate.)
- The target bond on the substrate is broken, and its electrons are pushed towards the TPP. This creates a double bond between the substrate carbon and the TPP carbon and pushes the electrons in the N-C double bond in TPP entirely onto the nitrogen atom, reducing it from a positive to neutral form.
- In what is essentially the reverse of step two, the electrons push back in the opposite direction forming a new bond between the substrate carbon and another atom. (In the case of the decarboxylases, this creates a new carbon-hydrogen bond. In the case of transketolase, this attacks a new substrate molecule to form a new carbon-carbon bond.)
- In what is essentially the reverse of step one, the TPP-substrate bond is broken, reforming the TPP ylid and the substrate carbonyl.
The TPP thiazolium ring can be deprotonated at C2 to become an ylid:
:Image:TPP_thiazolium.svg{{clear-left}}
A full view of TPP. The arrow indicates the acidic proton.
:Image:Thiamine pyrophosphate ng.png{{clear-left}}
See also
References
{{reflist}}
External links
- [http://www.uic.edu/classes/phar/phar332/Clinical_Cases/vitamin%20cases/thiamin/thiamin_pyrophosphate.htm UIC.edu]
{{Enzyme cofactors}}