Thymidine triphosphate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid =

| ImageFile=Desoxythymidintriphosphat protoniert.svg

| ImageSize=210

| ImageAlt = Skeletal formula of thymidine triphosphate, 3- negative charge

| ImageFile1 = Deoxythymidine triphosphate anion 3D spacefill.png

| ImageAlt1 = Space-filling model of the thymidine triphosphate molecule, 4- negative charge

| IUPACName = Thymidine 5′-(tetrahydrogen triphosphate)

| SystematicName = O¹-{[(2R,3S,5R)-5-(2,4-Dioxo-5-methyl-3,4-dihydropyrimidin-1(2H)-yl)-3-hydroxyoxolan-2-yl]methyl} tetrahydrogen triphosphate

| OtherNames = dTTP, 2′-Deoxythymidine triphosphate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}=

| ChemSpiderID = 58493

| ChEBI = 18077

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 363559

| InChI =

| InChIKey =

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}=

| StdInChI =

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}=

| StdInChIKey =

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=365-08-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = QOP4K539MU

| PubChem=64968

| IUPHAR_ligand = 5505

| SMILES = CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O

| MeSHName = thymidine+5'-triphosphate

}}

|Section2={{Chembox Properties

| Formula=C₁₀H₁₇N₂O₁₄P₃

| MolarMass= 482.168

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Thymidine triphosphate (TTP), also called deoxythymidine triphosphate (dTTP),

{{ Cite web

| url = http://pseudomonas.umaryland.edu/PAMDB?MetID=PAMDB000346

| title = Thymidine 5'-triphosphate (PAMDB000346)

| date = 2018-01-22

| website = University of Maryland, Baltimore

| access-date = 2023-10-29

| language = en

| url-status = live

| archive-url = https://web.archive.org/web/20231029215743/http://pseudomonas.umaryland.edu/PAMDB?MetID=PAMDB000346

| archive-date = 2023-10-29

}}

is one of the four nucleoside triphosphates that are used in the in vivo synthesis of DNA. Unlike the other deoxyribonucleoside triphosphates, thymidine triphosphate does not always contain the "deoxy" prefix in its name.{{cite book|title=The ACS style guide: effective communication of scientific information|year=2006|publisher=American Chemical Society|location=Washington, D.C.|isbn=978-0-8412-3999-9|edition=3rd|editor1=Coghill, Anne M.|editor2=Garson, Lorrin R.|page=[https://archive.org/details/acsstyleguideeff0000unse/page/244 244]|url=https://archive.org/details/acsstyleguideeff0000unse/page/244}} This is because dTTP does not have a corresponding ribonucleoside triphosphate, as the uridine triphosphate, which lacks thymidine's 5-methylation, is used instead.

dTTP is synthesized via the methylation of dUMP via thymidylate synthase.

It can be used by DNA ligase to create overlapping "sticky ends" so that protruding ends of opened microbial plasmids may be closed up.