Tixocortol

{{Short description|Medication}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 470611086

| IUPAC_name = (11β)-11,17-Dihydroxy-21-mercaptopregn-4-ene-3,20-dione

| image = Tixocortol.svg

| tradename =

| Drugs.com = {{drugs.com|CONS|tixocortol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 61951-99-3

| ATC_prefix = A07

| ATC_suffix = EA05

| ATC_supplemental = {{ATC|R01|AD07}}

| PubChem = 162955

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 143053

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZX3KEK657Z

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08610

| C=21 | H=30 | O=4 | S=1

| smiles = O=C4\C=C2/[C@]([C@H]1[C@@H](O)C[C@@]3([C@@](O)(C(=O)CS)CC[C@H]3[C@@H]1CC2)C)(C)CC4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H30O4S/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-26)20(15,2)10-16(23)18(14)19/h9,14-16,18,23,25-26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YWDBSCORAARPPF-VWUMJDOOSA-N

| synonyms = (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-mercaptoacetyl)-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one

}}

Tixocortol is a corticosteroid used as an intestinal anti-inflammatory{{cite journal | vauthors = Larochelle P, Du Souich P, Bolte E, Lelorier J, Goyer R | title = Tixocortol pivalate, a corticosteroid with no systemic glucocorticoid effect after oral, intrarectal, and intranasal application | journal = Clinical Pharmacology and Therapeutics | volume = 33 | issue = 3 | pages = 343–50 | date = March 1983 | pmid = 6402333 | doi = 10.1038/clpt.1983.43 | s2cid = 29876079 }} and decongestant.