Tixocortol pivalate

{{chembox

| Verifiedfields = changed

| verifiedrevid = 433985492

| ImageFile=Tixocortol pivalate.svg

| ImageSize=250px

| IUPACName=S-(11β,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl) 2,2-dimethylpropanethioate

| SystematicName=S-{2-[(1R,3aS,3bS,9aR,9bS,10S,11aS)-1,10-Dihydroxy-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]-2-oxoethyl} 2,2-dimethylpropanethioate

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=55560-96-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6K28E35M3B

| PubChem=15052414

| SMILES=CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)CSC(=O)C(C)(C)C)O)C)O

}}

|Section2={{Chembox Properties

| Formula=C₂₆H₃₈O₅S

| MolarMass=462.64

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Tixocortol pivalate is a corticosteroid. It has anti-inflammatory properties similar to hydrocortisone.{{cite journal|url = http://www.nature.com/clpt/journal/v33/n3/abs/clpt198343a.html | title = Tixocortol pivalate, a corticosteroid with no systemic glucocorticoid effect after oral, intrarectal, and intranasal application | author = P Larochelle MD, PhD | author2 = P Du Souich MD, PhD | author3 = E Bolte MD | author4 = J Lelorier MD, PhD | author5 = R Goyer PhD | name-list-style = amp | journal = Clinical Pharmacology and Therapeutics | year = 1983 | issue = 3| pages = 343–350 | doi = 10.1038/clpt.1983.43|access-date = 2011-03-29 | volume=33 | pmid=6402333| s2cid = 29876079 | url-access = subscription }} It is marketed under the brand name Pivalone.{{cite web | url = https://www.drugs.com/international/tixocortol-pivalate.html | title = Tixocortol Pivalate | work = Drugs.com | access-date = 2011-03-29}}

It is sometimes used in patch testing in atopic dermatitis.{{cite journal |vauthors=Nedorost ST, Babineau D |title=Patch testing in atopic dermatitis |journal=Dermatitis |volume=21 |issue=5 |pages=251–4 |date=October 2010 |pmid=20920410 |doi= 10.2310/6620.2010.10036|s2cid=25026888 |url=http://www.bcdecker.com/pubMedLinkOut.aspx?pub=AJCDO&vol=21&iss=5&page=251|url-access=subscription }}