Trifluoromescaline

{{Short description|Mescaline derivative}}

{{Drugbox

| IUPAC_name = 2-[3,5-dimethoxy-4-(trifluoromethoxy)phenyl]ethanamine

| image = Trifluoromescaline_structure.png

| tradename =

| legal_status =

| routes_of_administration =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number =

| ATC_prefix = none

| PubChem = 155884836

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID =

| UNII = R4ZT3L7Y4K

| C=11 | H=14 | F=3 | N=1 | O=3

| smiles = COc1cc(CCN)cc(OC)c1OC(F)(F)F

| StdInChI = 1S/C11H14F3NO3/c1-16-8-5-7(3-4-15)6-9(17-2)10(8)18-11(12,13)14/h5-6H,3-4,15H2,1-2H3

| StdInChIKey = AVPVNYDXWCNFJD-UHFFFAOYSA-N

}}

Trifluoromescaline (TF-M) is a derivative of the phenethylamine hallucinogen mescaline, which has a trifluoromethoxy group replacing the central methoxy group of mescaline. Trifluoromescaline was found to be one of the most potent compounds in the series, with a reported dosage of 15–40 mg (and 60 mg being described as a "strong overdose"), and a slow onset of action and long duration of effects, lasting 14–24 hours or more.{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C | title = Phenethylamine Von der Struktur zur Funktion | pages = 704–723 | publisher = Nachtschatten Verlag AG | date = 2013 | isbn = 978-3-03788-700-4 }}