2C-T-28

{{Short description|Psychedelic drug}}

{{chembox

| ImageFile = 2CT28_structure.png

| PIN = 2-[4-(3-fluoropropylsulfanyl)-2,5-dimethoxyphenyl]ethanamine

|Section1={{Chembox Identifiers

| InChI = 1S/C13H20FNO2S/c1-16-11-9-13(18-7-3-5-14)12(17-2)8-10(11)4-6-15/h8-9H,3-7,15H2,1-2H3

| InChIKey = XAFVGDRNPGLCMI-UHFFFAOYSA-N

| CASNo = 648957-54-4

| PubChem = 12063262

| ChemSpiderID = 129332309

| ChEMBL =

| SMILES = COC1=CC(=C(C=C1CCN)OC)SCCCF

}}

|Section2={{Chembox Properties

| Formula =

| C=13 | H=20 | F=1 | N=1 | O=2 | S=1

| Appearance =

| Density =

| MeltingPtC =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

2C-T-28, also known as 4-(3-fluoropropylthio)-2,5-dimethoxyphenethylamine, is a lesser-known psychedelic drug related to compounds such as 2C-T-7 and 2C-T-21. It was named by Alexander Shulgin but was never made or tested by him, and was instead first synthesised by Daniel Trachsel some years later. It has a binding affinity of 75 nM at 5-HT_2A and 28 nM at 5-HT_2C. It is reportedly a potent psychedelic drug with an active dose in the 8–20 mg range, and a duration of action of 8–10 hours, with prominent visual effects. 2C-T-28 is the 3-fluoropropyl instead of 2-fluoroethyl chain-lengthened homologue of 2C-T-21 and has very similar properties, although unlike 2C-T-21 it will not form toxic fluoroacetate as a metabolite.{{cite book | vauthors = Shulgin A, Manning T, Daley PF | title = The Shulgin Index. Volume 1. Psychedelic Phenethylamines and Related Compounds | page = 346 | publisher = Transform Press | date = 2011 | isbn = 978-0-9630096-3-0}}{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C |year=2013 |title=Phenethylamine: Von der Struktur zur Funktion | pages=789–794 |publisher=Nachtschatten Verlag AG |isbn=978-3-03788-700-4}}