Tropine

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444239133

| ImageFileL1 = Alpha-Tropanol.svg

| ImageClassL1 = skin-invert-image

| ImageFileR1 = Tropine.png

| PIN = (1R,3r,5S)-8-Methyl-8-azabicyclo[3.2.1]octan-3-ol

| OtherNames = α-Tropine; Tropanol

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 120-29-6

| PubChem = 8424

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7YXR19M72Y

| MeSHName = Tropine

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 10180559

| SMILES = CN1[C@@H]2CC[C@H]1C[C@H](C2)O

| InChI = 1/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+

| InChIKey = CYHOMWAPJJPNMW-JIGDXULJBD

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = CYHOMWAPJJPNMW-JIGDXULJSA-N

}}

| Section2 = {{Chembox Properties

| C=8|H=15|N=1|O=1

| Appearance = White hygroscopic crystalline powder{{cite web | url=https://pubchem.ncbi.nlm.nih.gov/compound/8424 | title=8-Methyl-8-azabicyclo[3.2.1]octan-3-ol }}{{Cite web | url=https://www.sigmaaldrich.com/GB/en/sds/aldrich/93550 | title=Safety Data Sheet - Tropine | website=www.sigmaaldrich.com}}{{cite web | url=https://www.merriam-webster.com/medical/tropine | title=Medical Definition of TROPINE }} or plates

| Odor = Amine-like

| Density = 1.045 g/cm³ at 25 °C
1.016 g/cm³ at 100 °C

| MeltingPtC = 64

| BoilingPtC = 233

| SolubleOther = Very soluble in water, diethyl ether, ethanol{{Citation | last = Lide | first = David R. | author-link = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, Florida | publisher = CRC Press | id = | isbn = 0-8493-0594-2 | doi = | oclc = | pages = 3–564 | url = | accessdate =}}

}}

| Section7 = {{Chembox Hazards

| MainHazards = Toxic

| LD50 = {{ubl|>2000 mg/kg (rat, oral)|139 mg/kg (mouse, intraperitoneal)|>50 mg/kg (rabbit, intravenous)|280 mg/kg (mouse, intraperitoneal)|>50 mg/kg (rabbit, intravenous)}}

| GHSPictograms = {{GHS06}}{{GHS07}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|H301|H302|H312|H332}}

| PPhrases = {{P-phrases|P261|P264|P270|P271|P280|P301+P316|P301+P317|P302+P352|P304+P340|P317|P321|P330|P362+P364|P405|P501}}

}}

}}

Tropine is a derivative of tropane containing a hydroxyl group at the third carbon. It is also called 3-tropanol. It is a poisonous white hygroscopic crystalline powder. It is a heterocyclic alcohol and an amine.

Tropine is a central building block of many chemicals active in the nervous system, including tropane alkaloids. Some of these compounds, such as long-acting muscarinic antagonists are used as medicines because of these effects.{{cite journal |last1=Ping |first1=Yu |last2=Li |first2=Xiaodong |last3=You |first3=Wenjing |last4=Li |first4=Guoqiang |last5=Yang |first5=Mengquan |last6=Wei |first6=Wenping |last7=Zhou |first7=Zhihua |last8=Xiao |first8=Youli |title=Production of the Plant-Derived Tropine and Pseudotropine in Yeast |journal=ACS Synthetic Biology |date=10 June 2019 |volume=8 |issue=6 |pages=1257–1262 |doi=10.1021/acssynbio.9b00152|pmid=31181154 |s2cid=184484993 }}