Pseudotropine

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| synonyms = 3β-Tropanol; 1αH,5αH-Tropan-3β-ol

| IUPAC_name = (1R,3R,5S)-8-Methyl-8-azabicyclo[3.2.1]octan-3-ol

| image = Pseudotropine.svg

| image_class = skin-invert-image

| CAS_number = 135-97-7

| PubChem = 449293

| ChemSpiderID =

| UNII = L9Q7Z9D09L

| ChEBI = 15742

| ChEMBL = 1235490

| C=8 | H=15 | N=1 | O=1

| smiles = CN1[C@@H]2CC[C@H]1C[C@@H](C2)O

| StdInChI = 1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8-

| StdInChIKey = CYHOMWAPJJPNMW-RNLVFQAGSA-N

}}

Pseudotropine (3β-tropanol, ψ-tropine, 3-pseudotropanol, or PTO) is a derivative of tropane and an isomer of tropine. Pseudotropine can be found in the Coca plant along with several other alkaloids {{cite journal | vauthors = Biondich AS, Joslin JD | title = Coca: The History and Medical Significance of an Ancient Andean Tradition | journal = Emergency Medicine International | volume = 2016 | pages = 4048764 | date = 2016 | pmid = 27144028 | pmc = 4838786 | doi = 10.1155/2016/4048764 | doi-access = free }}

See also

References

{{Reflist}}

Category:Tropanes

Category:Secondary alcohols

{{biochemistry-stub}}