Vonoprazan

{{Short description|Pharmaceutical compound}}

{{Use dmy dates|date=July 2024}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| image = Vonoprazan structure.svg

| alt = Skeletal formula of a vonoprazan molecule

| caption =

| pronounce =

| tradename = Voquezna, others

| Drugs.com = {{drugs.com|parent|Voquezna}}

| MedlinePlus = a624006

| DailyMedID = Vonoprazan

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration = By mouth

| class = Potassium-competitive acid blocker

| ATC_prefix = A02

| ATC_suffix = BC08

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Voquezna- vonoprazan fumarate tablet | website=DailyMed | date=8 November 2023 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=0cc52ac5-77ec-4d66-a770-762a1a960914 | access-date=20 November 2023}}

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Rx-only

| bioavailability = Unknown

| protein_bound = 80%

| metabolism = Liver, by cytochrome P450 (3A4, 2B6, 2C19, 2D6)

| metabolites =

| onset =

| elimination_half-life = 7.7 h

| duration_of_action = > 24 h

| excretion = Kidney

| index2_label = as fumarate

| CAS_number = 881681-00-1

| CAS_number2 = 1260141-27-2

| CAS_supplemental =

| PubChem = 15981397

| PubChem2 = 45375887

| IUPHAR_ligand =

| DrugBank = DB11739

| ChemSpiderID = 13112797

| UNII = 1R5L3J156G

| UNII2 = 4QW3X4AMLB

| KEGG = D11784

| KEGG2 = D10466

| ChEBI = 136048

| ChEMBL = 2079130

| ChEMBL2 = 2064032

| NIAID_ChemDB =

| PDB_ligand = HKT

| synonyms =

| IUPAC_name =

| C = 17 | H = 16 | F = 1 | N = 3 | O = 2 | S = 1

| SMILES = Fc1ccccc1-c2cc(CNC)cn2S(=O)(=O)c3cccnc3

| StdInChI = InChI=1S/C17H16FN3O2S/c1-19-10-13-9-17(15-6-2-3-7-16(15)18)21(12-13)24(22,23)14-5-4-8-20-11-14/h2-9,11-12,19H,10H2,1H3

| StdInChI_comment =

| StdInChIKey = BFDBKMOZYNOTPK-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Vonoprazan, sold under the brand name Voquezna among others, is a first-in-class potassium-competitive acid blocker medication. Vonoprazan is used in form of the fumarate for the treatment of gastroduodenal ulcer (including some drug-induced peptic ulcers) and reflux esophagitis, and can be combined with antibiotics for the eradication of Helicobacter pylori.{{cite journal |vauthors=Echizen H |title=The First-in-Class Potassium-Competitive Acid Blocker, Vonoprazan Fumarate: Pharmacokinetic and Pharmacodynamic Considerations |journal=Clinical Pharmacokinetics |volume=55 |issue=4 |pages=409–418 |date = April 2016 |pmid=26369775 |doi=10.1007/s40262-015-0326-7|s2cid=5984975 |doi-access=free }}

It was approved in Japan in February 2015,{{cite journal |vauthors=Garnock-Jones KP |title=Vonoprazan: first global approval |journal=Drugs |volume=75 |issue=4 |pages=439–43 |year=2015 |pmid=25744862 |doi=10.1007/s40265-015-0368-z|s2cid=43293048 }}{{cite press release | title=Takecab Now Available for the Treatment of Acid-related Diseases in Japan | website=Takeda Pharmaceuticals | date=26 February 2015 | url=https://www.takeda.com/newsroom/newsreleases/2015/takecab-now-available-for-the-treatment-of-acid-related-diseases-in-japan/ | access-date=20 November 2023 | archive-date=26 October 2023 | archive-url=https://web.archive.org/web/20231026071338/https://www.takeda.com/newsroom/newsreleases/2015/takecab-now-available-for-the-treatment-of-acid-related-diseases-in-japan/ | url-status=live }} and in Russia in April 2021.{{cite web |title=Russian State Register of Medicines. Vocinti (vonoprazan) Film-Coated Tablets. Full Prescribing Information |url=https://grls.rosminzdrav.ru/Grls_View_v2.aspx?routingGuid=17b9e1e6-c001-4811-b9e6-9252c4dcb861 |website=grls.rosminzdrav.ru |publisher=Takeda Pharmaceutical Company Limited |access-date=18 February 2023 |language=Russian |archive-date=18 February 2023 |archive-url=https://web.archive.org/web/20230218091924/https://grls.rosminzdrav.ru/Grls_View_v2.aspx?routingGuid=17b9e1e6-c001-4811-b9e6-9252c4dcb861 |url-status=live }} Vonoprazan was approved for medical use in the United States in November 2023.{{Cite press release |date=28 November 2023 |title=Phathom Pharmaceuticals Announces Commercial Availability of Voquezna (vonoprazan) Tablets, a Powerful First-In-Class PCAB for the Treatment of Erosive GERD and Relief of Associated Heartburn |url=https://www.globenewswire.com/news-release/2023/11/28/2786903/0/en/Phathom-Pharmaceuticals-Announces-Commercial-Availability-of-VOQUEZNA-vonoprazan-Tablets-a-Powerful-First-In-Class-PCAB-for-the-Treatment-of-Erosive-GERD-and-Relief-of-Associated-H.html |access-date=26 January 2024 |publisher=Phathom Pharmaceuticals | website=GlobeNewswire }} Co-packaged combinations of vonoprazan with amoxicillin and vonoprazan with amoxicillin and clarithromycin are available.{{cite web | title=Voquezna Dual Pak- vonoprazan fumarate and amoxicillin kit; Voquezna Triple Pak- vonoprazan fumarate, amoxicillin and clarithromycin kit | website=DailyMed | date=21 June 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=0cb2ee04-8581-46c8-a781-7be170ab5c86 | access-date=3 July 2022 | archive-date=3 July 2022 | archive-url=https://web.archive.org/web/20220703054730/https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=0cb2ee04-8581-46c8-a781-7be170ab5c86 | url-status=live }}{{cite press release | title=Phathom Pharmaceuticals Announces FDA Approval of Voquezna Triple Pak (vonoprazan, amoxicillin, clarithromycin) and Voquezna Dual Pak (vonoprazan, amoxicillin) for the Treatment of H. pylori Infection in Adults | publisher=Phathom Pharmaceuticals | via=GlobeNewswire | date=3 May 2022 | url=https://www.globenewswire.com/en/news-release/2022/05/03/2435147/0/en/Phathom-Pharmaceuticals-Announces-FDA-Approval-of-VOQUEZNA-TRIPLE-PAK-vonoprazan-amoxicillin-clarithromycin-and-VOQUEZNA-DUAL-PAK-vonoprazan-amoxicillin-for-the-Treatment-of-H-pylo.html | access-date=9 May 2022 | archive-date=10 May 2022 | archive-url=https://web.archive.org/web/20220510034341/https://www.globenewswire.com/en/news-release/2022/05/03/2435147/0/en/Phathom-Pharmaceuticals-Announces-FDA-Approval-of-VOQUEZNA-TRIPLE-PAK-vonoprazan-amoxicillin-clarithromycin-and-VOQUEZNA-DUAL-PAK-vonoprazan-amoxicillin-for-the-Treatment-of-H-pylo.html | url-status=live }}