WAY-261240
{{Short description|Chemical compound}}
{{drugbox
| drug_name = WAY-261240
| image = WAY-261240_structure.png
| C = 16 | H = 15 | Cl = 2 | N = 1 | O = 1
| IUPAC_name = [(2R)-8-(2,6-dichlorophenyl)-3,4-dihydro-2H-chromen-2-yl]methanamine
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 913825-01-1
| ChemSpiderID =
| PubChem = 17747578
| ChEMBL =
| UNII =
| smiles = C1CC2=C(C(=CC=C2)C3=C(C=CC=C3Cl)Cl)O[C@H]1CN
| StdInChI = 1S/C16H15Cl2NO/c17-13-5-2-6-14(18)15(13)12-4-1-3-10-7-8-11(9-19)20-16(10)12/h1-6,11H,7-9,19H2/t11-/m1/s1
| StdInChIKey = BNXPDLFCGJFNOG-LLVKDONJSA-N
}}
WAY-261240 is a drug which acts as a potent and selective 5-HT2C receptor agonist, though its affinity at other serotonin receptors has not been disclosed. It produces anorectic effects in animal studies. A large family of related derivatives is known.{{cite journal | vauthors = Lee J, Jung ME, Lee J | title = 5-HT2C receptor modulators: a patent survey | journal = Expert Opinion on Therapeutic Patents | volume = 20 | issue = 11 | pages = 1429–55 | date = November 2010 | pmid = 20849206 | doi = 10.1517/13543776.2010.518956 | s2cid = 32729624 }}{{cite patent | country = WO | number = 2006116165 | title = Chromane and chromene derivatives and uses thereof | inventor = Heffernan GD, Stack GP, Gross JL, Zhou D, Gao H | assign = Wyeth | pubdate = 2 November 2006 | url = https://patents.google.com/patent/WO2006116165A2 | postscript = . }}{{cite patent | country = WO | number = 2005044812 | title = Dihydrobenzofuranyl alkanamine derivatives as 5ht2c agonists | inventor = Gross JL, Williams MJ, Stack GP, Gao H, Zhou D | assign = Wyeth | pubdate = 19 May 2005 | url = https://patents.google.com/patent/WO2005044812A2 | postscript = . }}{{cite patent | country = WO | number = 2006116158 | title = Benzodioxane and benzodioxolane derivatives and uses thereof | inventor = Zhou D, Stack GP, Gross JL, Gao H | assign = Wyeth | pubdate = 2 November 2006 | url = https://patents.google.com/patent/WO2006116158A2 | postscript = . }}{{cite patent | country = WO | number = 2008052075 | title = Benzoxazine derivatives and uses thereof | inventor = Stack GP, Hatzenbuhler NT, Zhou D| assign = Wyeth | pubdate = 2 May 2008 | url = https://patents.google.com/patent/WO2008052075A2 | postscript = . }}{{cite patent | country = WO | number = 2008052078 | title = Benzoxathiine and benzoxathiole derivatives and uses thereof | inventor = Stack GP, Luoni G, Bianchi I, Vallese S | assign = Wyeth | pubdate = 2 May 2008 | url = https://patents.google.com/patent/WO2008052078A2 | postscript = . }}