abequose

{{Chembox

| ImageFile = abequose linear.svg

| ImageSize = 180px

| ImageAlt =

| SystematicName = (2R,4R,5R)-2,4,5-Trihydroxyhexanal

| IUPACName = 3,6-Dideoxy-D-xylo-hexose{{cite web | url=https://iupac.qmul.ac.uk/2carb/app.html | title=Appendix }}

| Section1 = {{Chembox Identifiers

| index1_label = pyranose

| CASNo = 56816-60-5

| CASNo1 = 644-48-4

| ChEBI = 27778

| ChemSpiderID = 4573722

| ChemSpiderID1 = 141071

| DrugBank = DB02590

| KEGG1 = C06471

| PubChem = 5460035

| PubChem1 = 160540

| SMILES = C[C@H]([C@@H](C[C@H](C=O)O)O)O

| UNII = ZP07RTT4BN

| StdInChI=1S/C6H12O4/c1-4(8)6(10)2-5(9)3-7/h3-6,8-10H,2H2,1H3/t4-,5-,6-/m1/s1

| StdInChIKey = GNTQICZXQYZQNE-HSUXUTPPSA-N

| InChI1=1S/C6H12O4/c1-3-4(7)2-5(8)6(9)10-3/h3-9H,2H2,1H3/t3-,4-,5-,6?/m1/s1

| InChIKey1 = KYPWIZMAJMNPMJ-JDJSBBGDSA-N

| SMILES1 = C[C@@H]1[C@@H](C[C@H](C(O1)O)O)O

}}

| Section2 = {{Chembox Properties

| C = 6 | H = 12 | O = 4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Abequose is a hexose and a 3,6-dideoxysugar. It is a constituent of the in O-specific chains in lipopolysaccharides that occur in certain serotypes of Salmonella{{cite web | url = https://www.oxfordreference.com/view/10.1093/oi/authority.20110803095343686 | title = Abequose | website = Oxford Reference | access-date = May 24, 2022 }}{{cite journal | doi = 10.1016/S0021-9258(18)93419-8 | doi-access = free | title = Biosynthesis of a Bacterial Lipopolysaccharide | year = 1968 | last1 = Osborn | first1 = M. J. | last2 = Weiner | first2 = I. M. | journal = Journal of Biological Chemistry | volume = 243 | issue = 10 | pages = 2631–2639 }} and Citrobacter bacteria.{{Cite journal | doi = 10.1016/j.carres.2009.06.005 | title = Structure of an abequose-containing O-polysaccharide from Citrobacter freundii O22 strain PCM 1555 | year = 2009 | last1 = Katzenellenbogen | first1 = Ewa | last2 = Kocharova | first2 = Nina A. | last3 = Toukach | first3 = Philip V. | last4 = Górska | first4 = Sabina | last5 = Korzeniowska-Kowal | first5 = Agnieszka | last6 = Bogulska | first6 = Maria | last7 = Gamian | first7 = Andrzej | last8 = Knirel | first8 = Yuriy A. | journal = Carbohydrate Research | volume = 344 | issue = 13 | pages = 1724–1728 | pmid = 19576576 }} It is the enantiomer of colitose.

References

{{reflist}}