acetryptine

{{Short description|Drug}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 1-[3-(2-Aminoethyl)-1H-indol-5-yl]ethanone

| image = Acetryptine.svg

| width = 200px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 3551-18-6

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 20810

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 19586

| UNII = N9VWZ34G5E

| KEGG =

| ChEBI =

| ChEMBL = 110317

| C=12 | H=14 | N=2 | O=1

| SMILES = CC(=O)C1=CC2=C(C=C1)NC=C2CCN

| StdInChI_Ref =

| StdInChI = 1S/C12H14N2O/c1-8(15)9-2-3-12-11(6-9)10(4-5-13)7-14-12/h2-3,6-7,14H,4-5,13H2,1H3

| StdInChIKey_Ref =

| StdInChIKey = RAUGYAOLAMRLLZ-UHFFFAOYSA-N

| synonyms = W-2965-A; 5-Acetyltryptamine; 5-Acetyl-3-(2-aminoethyl)indole;

}}

Acetryptine (INN; developmental code W-2965-A; also known as 5-acetyltryptamine or 5-AT{{cite journal | vauthors = HARTIGAN JM, PHILLIPS GE | title = Tissue distribution and metabolism of 5-acetyltryptamine in the mouse | journal = Biochem. Pharmacol. | volume = 12 | issue = 6| pages = 585–8 | year = 1963 | pmid = 13953098 | doi = 10.1016/0006-2952(63)90136-9}}) is a drug described as an antihypertensive agent which was never marketed.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA6|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=6–}} Structurally, acetryptine is a substituted tryptamine, and is closely related to other substituted tryptamines like serotonin (5-hydroxytryptamine). It was developed in the early 1960s. The binding of acetryptine to serotonin receptors does not seem to have been well-investigated, although it was assessed at the 5-HT_1A and 5-HT_1D receptors and found to bind to them with high affinity.{{cite journal | vauthors = Glennon RA, Hong SS, Bondarev M, Law H, Dukat M, Rakhi S, Power P, Fan E, Kinneau D, Kamboj R, Teitler M, Herrick-Davis K, Smith C | title = Binding of O-alkyl derivatives of serotonin at human 5-HT1D beta receptors | journal = J. Med. Chem. | volume = 39 | issue = 1 | pages = 314–22 | year = 1996 | pmid = 8568822 | doi = 10.1021/jm950498t }} The drug may also act as a monoamine oxidase inhibitor (MAOI); specifically, as an inhibitor of MAO-A.{{cite journal | vauthors = Veselovsky AV, Medvedev AE, Tikhonova OV, Skvortsov VS, Ivanov AS | title = Modeling of substrate-binding region of the active site of monoamine oxidase A | journal = Biochemistry Mosc. | volume = 65 | issue = 8 | pages = 910–6 | year = 2000 | pmid = 11002183 }}{{cite journal | vauthors = Ramsay RR, Gravestock MB | title = Monoamine oxidases: to inhibit or not to inhibit | journal = Mini Rev Med Chem | volume = 3 | issue = 2 | pages = 129–36 | year = 2003 | pmid = 12570845 | doi = 10.2174/1389557033405287}}