balsaminol A

{{Chembox

| Watchedfields = changed

| verifiedrevid = 443413552

| ImageFile = Balsaminol A.svg

| ImageAlt =

| IUPACName = (23R)-9-Methyl-19-nor-9β,10α-lanosta-5,24-diene-3β,7β,23,29-tetrol

| SystematicName = (1R,3aS,3bR,4S,6S,7S,9aS,9bS,11aR)-6-(Hydroxymethyl)-1-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-3a,6,9b,11a-tetramethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthrene-4,7-diol

| OtherNames = Cucurbita-5,24-diene-3β,7β,23(R),29-tetraol; (3β,4β,7β,9β,10α,23R)-4-(Hydroxymethyl)-4,9,14-trimethyl-19-norcholesta-5,24-diene-3,7,23-triol

|Section1={{Chembox Identifiers

| CASNo = 1189131-51-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XN2W8NF8BB

| PubChem = 44607276

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1078436

| SMILES = C[C@H](C[C@@H](O)/C=C(C)/C)[C@@]1([H])CC[C@@]2(C)[C@]3([H])[C@@H](O)C=C4[C@@](C)(CO)[C@@H](O)CC[C@@]4([H])[C@]3(C)CC[C@@]21C

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24655824

| SMILES1 = C[C@H](C[C@H](C=C(C)C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2[C@H](C=C4[C@H]3CC[C@@H]([C@]4(C)CO)O)O)C)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C30H50O4/c1-18(2)14-20(32)15-19(3)21-10-11-30(7)26-24(33)16-23-22(8-9-25(34)28(23,5)17-31)27(26,4)12-13-29(21,30)6/h14,16,19-22,24-26,31-34H,8-13,15,17H2,1-7H3/t19-,20+,21-,22-,24+,25+,26-,27+,28-,29-,30+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AVFNYXHRDYAHNF-HEVJPHJFSA-N

}}

|Section2={{Chembox Properties

| C=30 | H=50 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Balsaminol A or cucurbita-5,24-diene-3β,7β,23(R),29-tetraol, is a chemical compound with formula {{chem|C|30|H|50|O|4}}, found in the Balsam apple vine (Momordica balsamina). It is a cucurbitane-type triterpenoid, related to cucurbitacin, isolated by C. Ramalhete and others in 2009.{{cite journal |author1=Cátia Ramalhete |author2=Tayyab A. Mansoor |author3=Silva Mulhovo |author4=Joseph Molnár |author5=Maria-José U. Ferreira |name-list-style=amp | year = 2009 | pages = 2009–2013 | issue = 11 | title = Cucurbitane-Type Triterpenoids from the African Plant Momordica balsamina | volume = 72 | pmid = 19795842 | journal = Journal of Natural Products | doi = 10.1021/np900457u| hdl = 10884/1322 | hdl-access = free }}

Balsaminol A is an amorphous powder soluble in methanol and ethyl acetate but insoluble in n-hexane. It is cytotoxic at about 50 μM.

See also

References