caesium sulfate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 405204542

| Reference = {{RubberBible62nd|page=B-92}}.

| ImageFile1 = Caesium-sulfate-2D-structure.svg

| ImageFile2 = Structure of K2SO4, K2CrO4 and some related compounds.tif

| Name = Caesium sulfate

| OtherNames = Cesium sulfate

|Section1={{Chembox Identifiers

| InChI = 1/2Cs.H2O4S/c;;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*+1;/p-2

| SMILES = [Cs+].[Cs+].[O-]S([O-])(=O)=O

| InChIKey = FLJPGEWQYJVDPF-NUQVWONBAO

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2Cs.H2O4S/c;;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*+1;/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FLJPGEWQYJVDPF-UHFFFAOYSA-L

| CASNo = 10294-54-9

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 25137

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 8D6R91CS62

| EC_number = 233-662-6

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 23482

}}

|Section2={{Chembox Properties

| Formula = Cs₂SO₄

| MolarMass = 361.87 g/mol

| Density = 4.243 g/cm³, solid

| MeltingPtC = 1010

| Solubility = 167 g/100 ml (0 °C)
179 g/100 ml (20 °C)

| SolubleOther = insoluble in ethanol, acetone

| MagSus = −116.0·10⁻⁶ cm³/mol

}}

|Section7={{Chembox Hazards

| FlashPt = Non-flammable

| LD50 = 2830 mg/kg (oral, rat)https://chem.nlm.nih.gov/chemidplus/rn/10294-54-9 {{Dead link|date=March 2022}}

| GHSSignalWord = Warning

| GHSPictograms = {{GHS07}}{{GHS08}}

| HPhrases = {{H-phrases|302|361|412}}

| PPhrases = {{P-phrases|201|202|264|270|273|281|301+312|308+313|330|405|501}}

}}

|Section8={{Chembox Related

| OtherAnions = Caesium hydrogen sulfate

| OtherCations = Lithium sulfate
Sodium sulfate
Potassium sulfate
Rubidium sulfate

}}

}}

Caesium sulfate or cesium sulfate is the inorganic compound and salt with the formula Cs₂SO₄. It is a white water-soluble solid that is used to prepare dense aqueous solutions for use in isopycnic (or "density-gradient") centrifugation. It is isostructural with potassium salt.Nord, A.G. "The crystal structure of cesium sulfate, beta-Cs₂SO₄" Acta Chemica Scandinavica, Series A: 1976, 30, p198.

File:TopView10cnK.tif|Coordination sphere of one of two types of Cs⁺ site in Cs₂SO₄.

File:SO4sphere.tif|Environment of sulfate anion in β-Cs₂SO₄.