chebulinic acid

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 404156329

| ImageFile = Chebulinic acid.svg

| ImageSize = 200px

| IUPACName =

| OtherNames = 1,3,6-Tri-O-galloyl-2,4-chebuloyl-β-D-glucopyranoside{{Cite journal | url = http://www.arkat-usa.org/get-file/20031/ | title = The structural and conformational analyses and antioxidant activities of chebulinic acid and its thrice-hydrolyzed derivative, 2,4-chebuloyl-β-D-glucopyranoside, isolated from the fruit of Terminalia chebula | author = Karel D. Klika, Ammar Saleem, Jari Sinkkonen, Marja Kähkönen, Jyrki Loponen, Petri Tähtinen and Kalevi Pihlaja | journal = Arkivoc | date = 2004 | volume = vii | pages = 83–105}}

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changedt|chemspider}}

| ChemSpiderID = 219295

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 501154

| InChI = 1S/C41H32O27/c42-15-1-10(2-16(43)26(15)51)35(56)62-9-22-31-33(66-36(57)11-3-17(44)27(52)18(45)4-11)34(41(63-22)68-37(58)12-5-19(46)28(53)20(47)6-12)67-38(59)13-7-21(48)29(54)32-25(13)24(30(55)40(61)65-32)14(8-23(49)50)39(60)64-31/h1-7,14,22,24,30-31,33-34,41-48,51-55H,8-9H2,(H,49,

50)/t14-,22+,24-,30-,31+,33-,34+,41-/m0/s1

| InChIKey = YGVHOSGNOYKRIH-FJPMMHPYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 18942-26-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HVC8VQJ6EK

| PubChem = 12401

| SMILES = C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C(C(C(=O)O3)CC(=O)O)C(C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O

}}

|Section2={{Chembox Properties

| C=41 | H=32 | O=27

| Appearance =

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Chebulinic acid is an ellagitannin found in the seeds of Euphoria longana, in the fruits of Terminalia chebula{{Cite journal | doi = 10.1002/jssc.200600089 | title = Preparative isolation of hydrolysable tannins chebulagic acid and chebulinic acid from Terminalia chebula by high-speed counter-current chromatography | journal = Journal of Separation Science | volume = 29 | issue = 11 | pages = 1653–1657 | year = 2006 | last1 = Han | first1 = Quanbin | last2 = Song | first2 = Jingzheng | last3 = Qiao | first3 = Chunfeng | last4 = Wong | first4 = Lina | last5 = Xu | first5 = Hongxi | pmid = 16922284 }} or in the leaves of T. macroptera.