cholesterol sulfate

{{Chembox

| ImageFile = Cholesterol sulfate.svg

| ImageSize = 250

| IUPACName = [(3S,8S,9S,10R,13R,14S,17R)-10,13-Dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate

| OtherNames = Cholest-5-en-3β-ol sulfate

| Section1 = {{Chembox Identifiers

| CASNo = 1256-86-6

| ChEBI = 41321

| ChEMBL = 1231592

| PubChem = 65076

| ChemSpiderID = 58586

| SMILES = C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C)C

| InChI = 1/C27H46O4S/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(31-32(28,29)30)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25H,6-8,10-17H2,1-5H3,(H,28,29,30)/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1

| InChIKey = BHYOQNUELFTYRT-DPAQBDIFBL

| StdInChI = 1S/C27H46O4S/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(31-32(28,29)30)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25H,6-8,10-17H2,1-5H3,(H,28,29,30)/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1

| StdInChIKey = BHYOQNUELFTYRT-DPAQBDIFSA-N

| UNII = KU576NT9O9

}}

| Section2 = {{Chembox Properties

| C=27 | H=46 | O=4 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| Autoignition =

}}

}}

Cholesterol sulfate, or cholest-5-en-3β-ol sulfate, is an endogenous steroid and the C3β sulfate ester of cholesterol.{{cite book|author=Peter M. Elias|title=Advances in Lipid Research: Skin Lipids|url=https://books.google.com/books?id=rTeaBQAAQBAJ&pg=PA45|date=21 January 2016|publisher=Elsevier|isbn=978-1-4832-1545-7|pages=45–46}}{{cite book|author1=P. Itin|author2=G. Jemec|title=Ichthyoses|url=https://books.google.com/books?id=paw6AQAAQBAJ&pg=PA59|date=15 September 2010|publisher=Karger Medical and Scientific Publishers|isbn=978-3-8055-9395-3|pages=59–}} It is formed from cholesterol by steroid sulfotransferases (SSTs) such as SULT2B1b (also known as cholesterol sulfotransferase) and is converted back into cholesterol by steroid sulfatase (STS). Accumulation of cholesterol sulfate in the skin is implicated in the pathophysiology of X-linked ichthyosis, a congenital disorder in which STS is non-functional and the body cannot convert cholesterol sulfate back into cholesterol.