cinnamedrine

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| image = Cinnamedrine.svg

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 90-86-8

| CAS_supplemental =

| PubChem = 5370611

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 4521391

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Y1245J8012

| KEGG = D03510

| ChEBI =

| ChEMBL = 2104503

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Cinnamylephedrine; N-Cinnamylephedrine

| IUPAC_name = 2-[methyl-[(E)-3-phenylprop-2-enyl]amino]-1-phenylpropan-1-ol

| C=19 | H=23 | N=1 | O=1

| SMILES = CC(C(C1=CC=CC=C1)O)N(C)C/C=C/C2=CC=CC=C2

| StdInChI = 1S/C19H23NO/c1-16(19(21)18-13-7-4-8-14-18)20(2)15-9-12-17-10-5-3-6-11-17/h3-14,16,19,21H,15H2,1-2H3/b12-9+

| StdInChIKey = YMJMZFPZRVMNCH-FMIVXFBMSA-N

}}

Cinnamedrine ({{Abbrlink|INN|International Nonproprietary Name}}, {{Abbrlink|USAN|United States Adopted Name}}), also known as N-cinnamylephedrine, is a sympathomimetic drug with similar effects relative to those of ephedrine.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA279|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=279–}}{{cite book|author1=I.K. Morton|author2=Judith M. Hall|title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA77|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=77–}} It also has some local anesthetic activity. Cinnamedrine was previously used, in combination with analgesics, as an antispasmodic to treat dysmenorrhea in the over-the-counter drug Midol in the 1980s.{{cite book|author=William Andrew Publishing|title=Pharmaceutical Manufacturing Encyclopedia, 3rd Edition|url=https://books.google.com/books?id=_J2ti4EkYpkC&pg=PA1027|date=22 October 2013|publisher=Elsevier|isbn=978-0-8155-1856-3|pages=1027–}} There is a case series of the drug being abused as a psychostimulant.{{cite journal | vauthors = Fellows KW, Giannini AJ | title = Cinnamedrine: potential for abuse | journal = J. Toxicol. Clin. Toxicol. | volume = 20 | issue = 1 | pages = 93–9 | year = 1983 | doi = 10.3109/15563658308990054 | pmid = 6887304 }}