cinoxate

{{Short description|UV filter used in sunscreens}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444600304

| Reference=Merck Index, 11th Edition, 2312.

| Name = Cinoxate

| ImageFile = cinoxate.svg

| ImageSize = 260

| ImageAlt = Ball-and-stick model of the cinoxate molecule

| ImageFile1 = Cinoxate-3D-spacefill.png

| ImageSize1 = 240

| ImageAlt1 = Space-filling model of the cinoxate molecule

| PIN = 2-Ethoxyethyl (2E)-3-(4-methoxyphenyl)prop-2-enoate

| OtherNames = 2-Ethoxyethyl p-methoxycinnamate

|Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5437O7N5BH

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4523729

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104045

| InChI = 1/C14H18O4/c1-3-17-10-11-18-14(15)9-6-12-4-7-13(16-2)8-5-12/h4-9H,3,10-11H2,1-2H3/b9-6+

| InChIKey = CMDKPGRTAQVGFQ-RMKNXTFCBV

| PubChem = 5373773

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D03512

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H18O4/c1-3-17-10-11-18-14(15)9-6-12-4-7-13(16-2)8-5-12/h4-9H,3,10-11H2,1-2H3/b9-6+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CMDKPGRTAQVGFQ-RMKNXTFCSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 104-28-9

| SMILES = O=C(OCCOCC)\C=C\c1ccc(OC)cc1

}}

|Section2={{Chembox Properties

| C=14 | H=18 | O=4

| Density = 1.102 g/cm³

| MeltingPtC = −25

| BoilingPtC = 184 to 187

| BoilingPt_notes = at 2 mmHg

}}

}}

Cinoxate is an organic compound used as an ingredient in some types of sunscreens. It is an ester formed from methoxycinnamic acid and 2-ethoxyethanol. It is a slightly yellow viscous liquid that is insoluble in water, but miscible with alcohols, esters, and vegetable oils.

It was approved as UV filter in the USA by the FDA in 1961, but it is not commonly used in cosmetic formulations anymore.{{Cite journal |last1=Pantelic|first1=Molly N.|last2=Wong|first2=Nikita|last3=Kwa |first3=Michael|last4=Lim |first4=Henry W.|date=24 February 2023 |title=Ultraviolet filters in the United States and European Union: A review of safety and implications for the future of US sunscreens |journal=Journal of the American Academy of Dermatology |volume=88 |issue=3 |pages=632–646 |doi=10.1016/j.jaad.2022.11.039 |pmid=36442641 }}