clofenetamine

{{Short description|Antihistamine and anticholinergic}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Clofenetamine.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Tranquilizer; Antihistamine; Anticholinergic; Antiparkinsonian agent

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 511-46-6

| CAS_supplemental =
2019-16-1 (hydrochloride)

| PubChem = 71812

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 64836

| UNII = 5YH9CQF0FP

| KEGG =

| ChEBI =

| ChEMBL = 2110777

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Phenoxethamine; Keithon

| IUPAC_name = 2-[1-(4-chlorophenyl)-1-phenylethoxy]-N,N-diethylethanamine

| C=20 | H=26 | Cl=1 | N=1 | O=1

| SMILES = CCN(CC)CCOC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)Cl

| StdInChI = 1S/C20H26ClNO/c1-4-22(5-2)15-16-23-20(3,17-9-7-6-8-10-17)18-11-13-19(21)14-12-18/h6-14H,4-5,15-16H2,1-3H3

| StdInChIKey = IKFQEQVEOQNTRJ-UHFFFAOYSA-N

}}

Clofenetamine ({{Abbrlink|INN|International Nonproprietary Name}}), also known as phenoxethamine or as Keithon, is a drug described as a tranquilizer, antihistamine, anticholinergic, and antiparkinsonian agent.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA295 | access-date=17 October 2024 | page=295}}{{cite book | vauthors = Ariëns EJ | title=Drug Design: Medicinal Chemistry: A Series of Monographs | volume = 6 | publisher=Academic Press | issue=v. 6 | year=2013 | isbn=978-1-4832-1608-9 | url=https://books.google.com/books?id=PQwlBQAAQBAJ&pg=PA12 | access-date=17 October 2024 | pages=12–13}} It is a derivative of diphenhydramine and is closely structurally related to mephenhydramine, chlorphenoxamine, and embramine, among other drugs. Clofenetamine was discovered by Searle in the 1940s and was first described in the literature by 1956.{{cite web | title=CLOFENETAMINE | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences (NCATS), U.S National Institutes of Health | url=https://drugs.ncats.io/substance/5YH9CQF0FP | access-date=17 October 2024 | quote = Clofenetamine is a haloxanthine antihistamine compound discovered by Searle & Co in the 1940s.}}