cocamidopropyl betaine
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476993061
| Name = Lauramidopropyl betaine
| ImageFile = Cocamidopropyl betaine.svg
| ImageFile_Ref = {{Chemboximage|correct|??}}
| ImageSize = 244
| ImageName = Structural formula of lauramidopropyl betaine
| ImageCaption = Lauramidopropyl betaine, the major component of cocamidopropyl betaine
| IUPACName = {[3-(Dodecanoylamino)propyl](dimethyl)ammonio}acetate
| SystematicName =
| OtherNames = 2-[(3-Dodecanamidopropyl)dimethylaminio]acetate
|Section1={{Chembox Identifiers
| CASNo = 61789-40-0
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 5OCF3O11KX
| PubChem = 20280
| ChemSpiderID = 19106
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 263-058-8
| SMILES = CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC([O-])=O
| SMILES1 = CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC(=O)[O-]
| SMILES2 = [O-]C(=O)C[N+](CCCNC(=O)CCCCCCCCCCC)(C)C
| StdInChI = 1S/C19H38N2O3/c1-4-5-6-7-8-9-10-11-12-14-18(22)20-15-13-16-21(2,3)17-19(23)24/h4-17H2,1-3H3,(H-,20,22,23,24)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/C19H38N2O3/c1-4-5-6-7-8-9-10-11-12-14-18(22)20-15-13-16-21(2,3)17-19(23)24/h4-17H2,1-3H3,(H-,20,22,23,24)
| StdInChIKey = MRUAUOIMASANKQ-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = MRUAUOIMASANKQ-UHFFFAOYAL}}
|Section2={{Chembox Properties
| C=19 | H=38 | N=2 | O=3
| AtmosphericOHRateConstant =
| Appearance = Clear to slight yellow liquid
| BoilingPt = >
| BoilingPtC = 100
| BoilingPt_notes=
| Density = 1.05 g/cm3
| HenryConstant =
| LogP =
| MeltingPt = <
| MeltingPtC = -10
| MeltingPt_notes=
| pKa =
| pKb =
| SolubleOther =
| Solvent =
| VaporPressure =
}}
|Section3={{Chembox Hazards
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R = 0
| AutoignitionPt =
| ExploLimits =
| FlashPt =
| LD50 =
| LC50 =
| MainHazards =
| PEL =
| REL =
| ExternalSDS =
| HPhrases = {{h-phrases|315|319|400}}
| PPhrases =
}}
}}
Cocamidopropyl betaine (CAPB) is a mixture of closely related organic compounds derived from coconut oil and dimethylaminopropylamine.Christian Nitsch, Hans-Joachim Heitland, Horst Marsen, Hans-Joachim Schlüussler, "Cleansing Agents" in Ullmann's Encyclopedia of Industrial Chemistry, 2005, Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a07_137}} CAPB is available as a viscous pale yellow solution and it is used as a surfactant in personal care products and animal husbandry. The name reflects that the major part of the molecule, the lauric acid group, is derived from coconut oil. Cocamidopropyl betaine to a significant degree has replaced cocamide DEA.
Production
Despite the name cocamidopropyl betaine, the molecule is not synthesized from betaine. Instead it is produced in a two-step manner, beginning with the reaction of dimethylaminopropylamine (DMAPA) with fatty acids from coconut or palm kernel oil (lauric acid, or its methyl ester, is the main constituent). The primary amine in DMAPA is more reactive than the tertiary amine, leading to its selective addition to form an amide. In the second step chloroacetic acid reacts with the remaining tertiary amine to form a quaternary ammonium center (a quaternization reaction).{{cite book | title = Amines: Synthesis, Properties and Applications | author = Stephen A. Lawrence | publisher = Cambridge University Press | date = 2004 | page = 281}}
:CH3(CH2)10COOH + H2NCH2CH2CH2N(CH3)2 → CH3(CH2)10CONHCH2CH2CH2N(CH3)2
:CH3(CH2)10CONHCH2CH2CH2N(CH3)2 + ClCH2CO2H + NaOH → CH3(CH2)10CONHCH2CH2CH2N+(CH3)2CH2CO2− + NaCl + H2O
Chemistry
CAPB is a fatty acid amide that contains a long hydrocarbon chain at one end and a polar group at the other. This allows CAPB to act as a surfactant and as a detergent. It is a zwitterion, consisting of both a quaternary ammonium cation and a carboxylate.{{cn|date=September 2023}}
Specifications and properties
Cocamidopropyl betaine is used as a foam booster in shampoos.{{cite encyclopedia|last=Reich|first=Charles|editor1=Martin M. Rieger|editor2=Linda D. Rhein|encyclopedia=Surfactants in Cosmetics|title=Hair Cleansers|url=https://books.google.com/books?id=2DcyKqj6dDsC&pg=PA361|accessdate=9 December 2012|edition=2nd|series=Surfactant Science Series|volume=68|year=1997|publisher=Marcel Dekker, Inc.|location=New York|isbn=978-0-8247-9805-5|page=359}} It is a medium-strength surfactant also used in bath products like hand soaps. It is also used in cosmetics as an emulsifying agent and thickener, and to reduce the irritation that purely ionic surfactants would cause. It also serves as an antistatic agent in hair conditioners, which most often does not irritate skin or mucous membranes. However, some studies indicate it is an allergen.
CAPB is also used as a co-surfactant with Sodium dodecyl sulfate for promoting the formation of gas hydrates.{{cite journal|last1=Hande|first1=Vrushali|last2=Choudhary|first2=Nilesh|last3=Chakrabarty|first3=Suman|last4=Kumar|first4=Rajnish|date=2020-12-01|title=Morphology and dynamics of self-assembled structures in mixed surfactant systems (SDS + CAPB) in the context of methane hydrate growth|url=http://www.sciencedirect.com/science/article/pii/S016773222034037X|journal=Journal of Molecular Liquids|language=en|volume=319|pages=114296|doi=10.1016/j.molliq.2020.114296|s2cid=224848279|issn=0167-7322|access-date=2020-10-10|archive-date=2021-03-09|archive-url=https://web.archive.org/web/20210309104949/https://www.sciencedirect.com/science/article/abs/pii/S016773222034037X|url-status=live}} CAPB, as an additive, helps to scale up the gas hydrates' formation process.{{cite journal|last1=Bhattacharjee|first1=Gaurav|last2=Kushwaha|first2=Omkar Singh|last3=Kumar|first3=Asheesh|last4=Khan|first4=Muzammil Yusuf|last5=Patel|first5=Jay Narayan|last6=Kumar|first6=Rajnish|date=2017-04-05|title=Effects of Micellization on Growth Kinetics of Methane Hydrate|url=https://doi.org/10.1021/acs.iecr.7b00328|journal=Industrial & Engineering Chemistry Research|volume=56|issue=13|pages=3687–3698|doi=10.1021/acs.iecr.7b00328|issn=0888-5885|access-date=2020-10-10|archive-date=2021-03-09|archive-url=https://web.archive.org/web/20210309104952/https://pubs.acs.org/doi/10.1021/acs.iecr.7b00328|url-status=live}}
CAPB is obtained as an aqueous solution in concentrations of about 30%.
Typical impurities of leading manufacturers today:
- Sodium monochloroacetate < 5 ppm
- Amidoamine (AA) < 0.3%
- Dimethylaminopropylamine (DMAPA) < 15 ppm
- Glycerol < 3%
The impurities AA and DMAPA are most critical, as they have been shown to be responsible for skin sensitization reactions. These by-products can be avoided by a moderate excess chloroacetate and the exact adjustment of pH value during betainization reaction accompanied by regular analytical control.
Safety
CAPB has been claimed to cause allergic reactions in some users,{{cite journal
| doi = 10.1111/j.1600-0536.1995.tb02078.x
| last1 = De Groot | first1 = A. C.
| last2 = Van Der Walle | first2 = H. B.
| last3 = Weyland | first3 = J. W.
| title = Contact allergy to cocamidopropyl betaine
| journal = Contact Dermatitis
| volume = 33
| issue = 6
| pages = 419–422
| year = 1995
| pmid = 8706401
| s2cid = 42960180 }}{{cite journal
| doi = 10.1111/j.1440-0960.1998.tb01264.x
| last1 = Brand | first1 = R.
| last2 = Delaney | first2 = T. A.
| title = Allergic contact dermatitis to cocamidopropylbetaine in hair shampoo
| journal = The Australasian Journal of Dermatology
| volume = 39
| issue = 2
| pages = 121–122
| year = 1998
| pmid = 9611386
| s2cid = 9381720 }}{{cite journal
| last1 = Mowad | first1 = C.
| title = Cocamidopropyl betaine allergy
| doi = 10.1053/ajcd.2001.29549
| journal = American Journal of Contact Dermatitis
| volume = 12
| issue = 4
| pages = 223–224
| year = 2001
| pmid = 11753899
| pmc =
}} but a controlled pilot study has found that these cases may represent irritant reactions rather than true allergic reactions.{{cite journal
| last1 = Shaffer | first1 = K. K.
| last2 = Jaimes | first2 = J. P.
| last3 = Hordinsky | first3 = M. K.
| last4 = Zielke | first4 = G. R.
| last5 = Warshaw | first5 = E. M.
| title = Allergenicity and cross-reactivity of coconut oil derivatives: A double-blind randomized controlled pilot study
| journal = Dermatitis: Contact, Atopic, Occupational, Drug
| volume = 17
| issue = 2
| pages = 71–76
| year = 2006
| pmid = 16956456
}} Furthermore, results of human studies have shown that CAPB has a low sensitizing potential if impurities with amidoamine (AA) and dimethylaminopropylamine (DMAPA) are low and tightly controlled.{{cite journal
| last1 = Fowler Jr
| first1 = J. F.
| last2 = Zug
| first2 = K. M.
| last3 = Taylor
| first3 = J. S.
| last4 = Storrs
| first4 = F. J.
| last5 = Sherertz
| first5 = E. A.
| last6 = Sasseville
| first6 = D. A.
| last7 = Rietschel
| first7 = R. L.
| last8 = Pratt
| first8 = M. D.
| last9 = Mathias
| first9 = C. G.
| last10 = Marks
| first10 = J. G.
| last11 = Maibach
| first11 = H. I.
| last12 = Fransway
| first12 = A. F.
| last13 = Deleo
| first13 = V. A.
| last14 = Belsito
| first14 = D. V.
| title = Allergy to cocamidopropyl betaine and amidoamine in North America
| journal = Dermatitis: Contact, Atopic, Occupational, Drug
| volume = 15
| issue = 1
| pages = 5–6
| year = 2004
| pmid = 15573641
| doi =
| url = https://journals.lww.com/dermatitis/Abstract/2004/03000/Allergy_to_Cocamidopropyl_Betaine_and_Amidoamine.3.aspx
| access-date = 2022-06-24
| archive-date = 2022-06-25
| archive-url = https://web.archive.org/web/20220625053945/https://journals.lww.com/dermatitis/Abstract/2004/03000/Allergy_to_Cocamidopropyl_Betaine_and_Amidoamine.3.aspx
| url-status = live
| doi = 10.1016/S0190-9622(08)80270-8
| last1 = Korting | first1 = H. C.
| last2 = Parsch | first2 = E. M.
| last3 = Enders | first3 = F.
| last4 = Przybilla | first4 = B.
| title = Allergic contact dermatitis to cocamidopropyl betaine in shampoo
| journal = Journal of the American Academy of Dermatology
| volume = 27
| issue = 6 Pt 1
| pages = 1013–1015
| year = 1992
| pmid = 1479082
}} Other studies have concluded that most apparent allergic reactions to CAPB are more likely due to amidoamine.{{cite journal
| doi = 10.1034/j.1600-0536.2003.00078.x
| last1 = Foti | first1 = C.
| last2 = Bonamonte | first2 = D.
| last3 = Mascolo | first3 = G.
| last4 = Corcelli | first4 = A.
| last5 = Lobasso | first5 = S.
| last6 = Rigano | first6 = L.
| last7 = Angelini | first7 = G.
| s2cid = 9944011 | title = The role of 3-dimethylaminopropylamine and amidoamine in contact allergy to cocamidopropylbetaine
| journal = Contact Dermatitis
| volume = 48
| issue = 4
| pages = 194–198
| year = 2003
| pmid = 12786723
| doi = 10.1111/j.1600-0536.1997.tb02464.x
| last1 = Fowler | first1 = J. F.
| last2 = Fowler | first2 = L. M.
| last3 = Hunter | first3 = J. E.
| title = Allergy to cocamidopropyl betaine may be due to amidoamine: A patch test and product use test study
| journal = Contact Dermatitis
| volume = 37
| issue = 6
| pages = 276–281
| year = 1997
| pmid = 9455630
| s2cid = 7933812 }} Cocamidopropyl betaine was voted 2004 Allergen of the Year by the American Contact Dermatitis Society.[http://www.contactderm.org/i4a/pages/index.cfm?pageid=3467 History of Allergen of the Year] {{Webarchive|url=https://web.archive.org/web/20140425021024/http://www.contactderm.org/i4a/pages/index.cfm?pageid=3467 |date=2014-04-25 }}. contactderm.org