cucurbalsaminol B

{{Chembox

| verifiedrevid = 428751970

| ImageFile = Cucurbalsaminol B.svg

| ImageSize =

| ImageAlt =

| IUPACName = (23E)-7β-Methoxy-9-methyl-19-nor-9β,10α-lanosta-5,23-diene-3β,12β,25-triol

| SystematicName = (1R,3aS,3bR,4S,7S,9aS,9bS,11R,11aR)-1-[(2R,4E)-6-Hydroxy-6-methylhept-4-en-2-yl]-4-methoxy-3a,6,6,9b,11a-pentamethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthrene-7,11-diol

| OtherNames = 7β-Methoxycucurbita-(5,23E)-diene-3β,12β,25-triol; (3β,7β,9β,10α,12β,23E)-7-methoxy-4,4,9,14-tetramethyl-19-norcholesta-5,23-diene-3,12,23-triol

| Section1 = {{Chembox Identifiers

| CASNo = 1189131-55-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LCG2BV4NT5

| PubChem = 44607451

| ChEMBL = 1253844

| SMILES = C[C@H](C/C=C/C(O)(C)C)[C@@]1([H])CC[C@@]2(C)[C@]3([H])[C@@H](OC)C=C4C(C)(C)[C@@H](O)CC[C@@]4([H])[C@]3(C)C[C@@H](O)[C@@]21C

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 25991420

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C31H52O4/c1-19(11-10-15-27(2,3)34)20-14-16-30(7)26-23(35-9)17-22-21(12-13-24(32)28(22,4)5)29(26,6)18-25(33)31(20,30)8/h10,15,17,19-21,23-26,32-34H,11-14,16,18H2,1-9H3/b15-10+/t19-,20-,21-,23+,24+,25-,26-,29+,30+,31+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OSNWCRUHKQXEMA-KOBRMIIQSA-N

}}

| Section2 = {{Chembox Properties

| C=31 | H=52 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Cucurbalsaminol B or 7β-methoxycucurbita-5,23(E)-diene-3β,12β,25-triol, is a chemical compound with formula {{chem|C|31|H|52|O|4}}, found in the Balsam apple vine (Momordica balsamina). It is a cucurbitane-type triterpenoid, related to cucurbitacin, isolated by C. Ramalhete and others in 2009.{{cite journal |author1=Cátia Ramalhete |author2=Tayyab A. Mansoor |author3=Silva Mulhovo |author4=Joseph Molnár |author5=Maria-José U. Ferreira | year = 2009 | pages = 2009–2013 | issue = 11 | title = Cucurbitane-Type Triterpenoids from the African Plant Momordica balsamina | volume = 72 | pmid = 19795842 | journal = Journal of Natural Products | doi = 10.1021/np900457u| hdl = 10884/1322 | hdl-access = free }}

Cucurbalsaminol B is an amorphous powder soluble in methanol and ethyl acetate but insoluble in n-hexane. It is cytotoxic at about 50 μM.