cyclazocine
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 460109436
| IUPAC_name = 3-(Cyclopropylmethyl)-6,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol
or
2-Cyclopropylmethyl-2'-hydroxy-5,9-dimethyl-6,7-benzomorphan
| image = Cyclazocine structure.svg
| image_class = skin-invert-image
| width = 200
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration = By mouth
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|CAS}}
| CAS_number = 3572-80-3
| ATC_prefix = none
| ATC_suffix =
| PubChem = 19143
| IUPHAR_ligand = 1604
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 18063
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = J5W1B1159C
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03618
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 56585
| C = 18
| H = 25
| N = 1
| O = 1
| smiles = Oc1ccc4c(c1)C2(C(C(N(CC2)CC3CC3)C4)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H25NO/c1-12-17-9-14-5-6-15(20)10-16(14)18(12,2)7-8-19(17)11-13-3-4-13/h5-6,10,12-13,17,20H,3-4,7-9,11H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YQYVFVRQLZMJKJ-UHFFFAOYSA-N
}}
Cyclazocine is a mixed opioid agonist/antagonist related to dezocine, pentazocine and phenazocine. It is in the benzomorphan and benzazocine family of drugs.{{cite journal | vauthors = Archer S, Glick SD, Bidlack JM | title = Cyclazocine revisited | journal = Neurochemical Research | volume = 21 | issue = 11 | pages = 1369–1373 | date = November 1996 | pmid = 8947927 | doi = 10.1007/BF02532378 | s2cid = 680860 }} It is a κ-opioid receptor agonist and μ-opioid receptor partial agonist, and also has high affinity for the δ-opioid receptor.{{cite journal | vauthors = Bidlack JM, Cohen DJ, McLaughlin JP, Lou R, Ye Y, Wentland MP | title = 8-Carboxamidocyclazocine: a long-acting, novel benzomorphan | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 302 | issue = 1 | pages = 374–380 | date = July 2002 | pmid = 12065740 | doi = 10.1124/jpet.302.1.374 | s2cid = 15864569 }}
Research
Research into the use of cyclazocine for the treatment of bipolar patients with depression was undertaken by Fink and colleagues (1970). It showed that 8 out of 10 patients experienced moderate improvement.{{Citation needed|date=March 2025}}
Research during the 1960s and 1970s into the possible use of cyclazocine for management of pain, and later for assisting treatment of opioid addiction was severely hampered by the drug's psychotomimetic, dysphoric, and hallucinatory effects.{{cite journal | vauthors = Freedman AM, Fink M, Sharoff R, Zaks A | title = Cyclazocine and methadone in narcotic addiction | journal = JAMA | volume = 202 | issue = 3 | pages = 191–194 | date = October 1967 | pmid = 6072354 | doi = 10.1001/jama.1967.03130160065011 }} The dysphoric/anxiety-inducing effects of the drug correlate with increasing dosage and would likely reduce the risk of abuse in the same manner as other opioids which preferentially act on the KOR versus the DOR and MOR, although the side-effect threshold is often lower than the lowest effective dose.
References
{{Reflist}}
{{Analgesics}}
{{Hallucinogens}}
{{Opioid receptor modulators}}
{{Sigma receptor modulators}}