decene

{{short description|Organic compound (C10H20)}}

{{Distinguish|Decane|Decyne}}

{{Chembox

| Watchedfields = changed

| verifiedrevid = 443563584

| Name = Decene

| ImageFile1 = 1-decene.svg

| ImageFile2 = Dec-1-ene.svg

| PIN = Dec-1-ene

| OtherNames = Alpha Olefin C10; Decylene; α-Decene; 1-decene

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 12809

| InChI = 1/C10H20/c1-3-5-7-9-10-8-6-4-2/h3H,1,4-10H2,2H3

| InChIKey = AFFLGGQVNFXPEV-UHFFFAOYAO

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H20/c1-3-5-7-9-10-8-6-4-2/h3H,1,4-10H2,2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AFFLGGQVNFXPEV-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 872-05-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7O4U4C718P

| PubChem = 13381

| EINECS = 212-819-2

| RTECS = HE2071401

| UNNumber = 3295, 1993

| ChEBI = 87315

| ChEMBL = 3187990

| SMILES = CCCCCCCCC=C

}}

|Section2={{Chembox Properties

| C=10 | H=20

| Density = 0.74 g/cm3{{GESTIS|ZVG=493774}}

| MeltingPtC = -66.3

| MeltingPt_ref =

| BoilingPtC = 172

| BoilingPt_ref =

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS02}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|226|304|410}}

| PPhrases = {{P-phrases|210|233|240|241|242|243|273|280|301+310|303+361+353|331|370+378|391|403+235|405|501}}

}}

|Section8={{Chembox Related

| OtherFunction_label = Alkenes

| OtherFunction = Octene
Nonene
Undecene
Dodecene

| OtherCompounds = Decane
Decanol

}}

}}

Decene {{IPAc-en|d|ɛ|k|iː|n}} is an organic compound with the chemical formula {{chem2|C10H20}}. Decene contains a chain of ten carbon atoms with one double bond, making it an alkene. There are many isomers of decene depending on the position and geometry of the double bond. Dec-1-ene is the only isomer of industrial importance. As an alpha olefin, it is used as a comonomer in copolymers and is an intermediate in the production of epoxides, amines, oxo alcohols, synthetic lubricants, synthetic fatty acids and alkylated aromatics.http://www.ineosoligomers.com/media/files/lao/LAO%20C10%20Data%20Sheet.pdf 1-Decene (Alpha Olefin C10)], ineosoligomers.com

The industrial processes used in the production of dec-1-ene are oligomerization of ethylene by the Ziegler process or by the cracking of petrochemical waxes.[http://www.inchem.org/documents/sids/sids/AOalfaolefins.pdf Alfa Olefins] {{Webarchive|url=https://web.archive.org/web/20170517120901/http://www.inchem.org/documents/sids/sids/AOalfaolefins.pdf |date=2017-05-17 }}, SIDS Initial Assessment Report

In ethenolysis, methyl oleate, the methyl ester of oleic acid, converts to 1-decene and methyl 9-decenoate:{{ cite journal | last = Marinescu | first = Smaranda C. | last2 = Schrock | first2 = Richard R. | last3 = Müller | first3 = Peter | last4 = Hoveyda | first4 = Amir H. | title = Ethenolysis Reactions Catalyzed by Imido Alkylidene Monoaryloxide Monopyrrolide (MAP) Complexes of Molybdenum | journal = J. Am. Chem. Soc. | year = 2009 | volume = 131 | issue = 31 | pages = 10840–10841 | doi = 10.1021/ja904786y | pmid=19618951}}

::\overset{\text{methyl oleate}}{\ce{CH3(CH2)7CH=CH(CH2)7CO2Me}} + {\color{red}\ce{CH2=CH2}} \longrightarrow \overset{\text{1-decene}}{\ce{CH3(CH2)7CH=}{\color{red}\ce{CH2}}} + \overset{\text{9-decenoate}}{\ce{MeO2C(CH2)7CH=}{\color{red}\ce{CH2}}}

Dec-1-ene has been isolated from the leaves and rhizome of the plant Farfugium japonicum and has been detected as the initial product in the microbial degradation of n-decane.

References

{{reflist}}