dehydrocholic acid

{{chembox

| Name = Dehydrocholic acid

| ImageFile = Dehydrocholic acid.svg

| ImageSize = 200px

| ImageName =

| IUPACName = 3,7,12-Trioxo-5β-cholan-24-oic acid

| SystematicName = (4R)-[(1R,3aS,3bR,5aS,9aS,9bS,11aR)-9a,11a-Dimethyl-4,7,11-trioxohexadecahydro-1H-cyclopenta[a]phenanthren-1-yl]pentanoic acid

| OtherNames =

| Section1 = {{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NH5000009I

| ChemSpiderID = 6422

| InChI = 1/C24H34O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-18,22H,4-12H2,1-3H3,(H,28,29)/t13-,14+,16-,17+,18+,22+,23+,24-/m1/s1

| InChIKey = OHXPGWPVLFPUSM-KLRNGDHRBE

| CASNo = 81-23-2

| PubChem = 6674

| ChEMBL = 514446

| KEGG = D01693

| SMILES = O=C2C[C@H]3CC(=O)[C@H]1[C@H]4[C@](C(=O)C[C@@H]1[C@@]3(C)CC2)([C@H](CC4)[C@H](C)CCC(=O)O)C

}}

| Section2 = {{Chembox Properties

| C=24 | H=34 | O=5

| Density =

| MeltingPt =

| BoilingPt =

}}

| Section3 =

| Section4 =

| Section5 =

| Section6 =

}}

Dehydrocholic acid is a synthetic bile acid, manufactured by the oxidation of cholic acid. It acts as a hydrocholeretic, increasing bile output to clear increased bile acid load.{{cite journal |vauthors=Yousef IM, Barnwell SG, Tuchweber B, Weber A, Roy CC |title=Effect of complete sulfation of bile acids on bile formation in rats |journal=Hepatology |volume=7 |issue=3 |pages=535–42 |year=1987 |pmid=3570165 |doi=10.1002/hep.1840070320|s2cid=20960189 |doi-access=free }}